EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:66955 - olivetolic acid
| Formula | C12H16O4 |
| Net Charge | 0 |
| Average Mass | 224.256 |
| Monoisotopic Mass | 224.10486 |
| SMILES | CCCCCc1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C12H16O4/c1-2-3-4-5-8-6-9(13)7-10(14)11(8)12(15)16/h6-7,13-14H,2-5H2,1H3,(H,15,16) |
| InChIKey | SXFKFRRXJUJGSS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olivetolic acid (CHEBI:66955) has functional parent olivetol (CHEBI:66960) |
| olivetolic acid (CHEBI:66955) has role metabolite (CHEBI:25212) |
| olivetolic acid (CHEBI:66955) is a benzoic acids (CHEBI:22723) |
| olivetolic acid (CHEBI:66955) is a monocarboxylic acid (CHEBI:25384) |
| olivetolic acid (CHEBI:66955) is a polyketide (CHEBI:26188) |
| olivetolic acid (CHEBI:66955) is a resorcinols (CHEBI:33572) |
| olivetolic acid (CHEBI:66955) is conjugate acid of olivetolate (CHEBI:66950) |
| Incoming Relation(s) |
| cannabidiolic acid (CHEBI:3359) has functional parent olivetolic acid (CHEBI:66955) |
| cannabigerolic acid (CHEBI:67081) has functional parent olivetolic acid (CHEBI:66955) |
| cannabinerolic acid (CHEBI:67080) has functional parent olivetolic acid (CHEBI:66955) |
| cytonic acid A (CHEBI:65717) has functional parent olivetolic acid (CHEBI:66955) |
| cytonic acid B (CHEBI:65718) has functional parent olivetolic acid (CHEBI:66955) |
| olivetolate (CHEBI:66950) is conjugate base of olivetolic acid (CHEBI:66955) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-6-pentylbenzoic acid |
| Synonyms | Source |
|---|---|
| 6-pentyl-beta-resorcylic acid | ChEBI |
| allazetolcarboxylic acid | ChemIDplus |
| olivetolcarboxylic acid | ChemIDplus |
| Citations |
|---|