EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c1C(=O)O |
| InChI | InChI=1S/C22H32O4/c1-5-6-7-11-17-14-19(23)18(21(24)20(17)22(25)26)13-12-16(4)10-8-9-15(2)3/h9,12,14,23-24H,5-8,10-11,13H2,1-4H3,(H,25,26)/b16-12+ |
| InChIKey | SEEZIOZEUUMJME-FOWTUZBSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cannabigerolic acid (CHEBI:67081) has functional parent olivetolic acid (CHEBI:66955) |
| cannabigerolic acid (CHEBI:67081) is a dihydroxybenzoic acid (CHEBI:23778) |
| cannabigerolic acid (CHEBI:67081) is a diterpenoid (CHEBI:23849) |
| cannabigerolic acid (CHEBI:67081) is a phytocannabinoid (CHEBI:67196) |
| cannabigerolic acid (CHEBI:67081) is a polyketide (CHEBI:26188) |
| cannabigerolic acid (CHEBI:67081) is a resorcinols (CHEBI:33572) |
| cannabigerolic acid (CHEBI:67081) is conjugate acid of cannabigerolate (CHEBI:66962) |
| Incoming Relation(s) |
| cannabigerolate (CHEBI:66962) is conjugate base of cannabigerolic acid (CHEBI:67081) |
| IUPAC Name |
|---|
| 3-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-2,4-dihydroxy-6-pentylbenzoic acid |
| Synonym | Source |
|---|---|
| (E)-3-(3,7-Dimethyl-2,6-octadienyl)-2,4-dihydroxy-6-pentylbenzoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-7166 | MetaCyc |
| US2011021617 | Patent |
| WO2011017798 | Patent |
| US2011038958 | Patent |
| GB2468828 | Patent |
| WO2009087351 | Patent |
| GB2456183 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2820770 | Reaxys |
| CAS:25555-57-1 | ChemIDplus |
| Citations |
|---|