EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36O10 |
| Net Charge | 0 |
| Average Mass | 580.630 |
| Monoisotopic Mass | 580.23085 |
| SMILES | CCCCCc1cc(OC(=O)c2c(O)cc(OC(=O)c3c(O)cc(O)cc3CCC)cc2CCC)cc(O)c1C(=O)O |
| InChI | InChI=1S/C32H36O10/c1-4-7-8-11-20-14-23(16-25(35)27(20)30(37)38)42-32(40)29-19(10-6-3)13-22(17-26(29)36)41-31(39)28-18(9-5-2)12-21(33)15-24(28)34/h12-17,33-36H,4-11H2,1-3H3,(H,37,38) |
| InChIKey | NUJLMXRQKUYQKE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cytonaema (mycobank:7899) | - | PubMed (10843568) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytonic acid B (CHEBI:65718) has functional parent olivetolic acid (CHEBI:66955) |
| cytonic acid B (CHEBI:65718) has role antiviral agent (CHEBI:22587) |
| cytonic acid B (CHEBI:65718) has role metabolite (CHEBI:25212) |
| cytonic acid B (CHEBI:65718) has role protease inhibitor (CHEBI:37670) |
| cytonic acid B (CHEBI:65718) is a benzoate ester (CHEBI:36054) |
| cytonic acid B (CHEBI:65718) is a monohydroxybenzoic acid (CHEBI:25389) |
| cytonic acid B (CHEBI:65718) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 4-({4-[(2,4-dihydroxy-6-propylbenzoyl)oxy]-2-hydroxy-6-propylbenzoyl}oxy)-2-hydroxy-6-pentylbenzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8667710 | Reaxys |
| Citations |
|---|