EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36O10 |
| Net Charge | 0 |
| Average Mass | 580.630 |
| Monoisotopic Mass | 580.23085 |
| SMILES | CCCCCc1cc(OC(=O)c2c(O)cc(OC(=O)c3c(O)cc(O)cc3CCC)cc2CCC)cc(O)c1C(=O)O |
| InChI | InChI=1S/C32H36O10/c1-4-7-8-11-20-14-23(16-25(35)27(20)30(37)38)42-32(40)29-19(10-6-3)13-22(17-26(29)36)41-31(39)28-18(9-5-2)12-21(33)15-24(28)34/h12-17,33-36H,4-11H2,1-3H3,(H,37,38) |
| InChIKey | NUJLMXRQKUYQKE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cytonaema (mycobank:7899) | - | PubMed (10843568) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytonic acid B (CHEBI:65718) has functional parent olivetolic acid (CHEBI:66955) |
| cytonic acid B (CHEBI:65718) has role antiviral agent (CHEBI:22587) |
| cytonic acid B (CHEBI:65718) has role metabolite (CHEBI:25212) |
| cytonic acid B (CHEBI:65718) has role protease inhibitor (CHEBI:37670) |
| cytonic acid B (CHEBI:65718) is a benzoate ester (CHEBI:36054) |
| cytonic acid B (CHEBI:65718) is a monohydroxybenzoic acid (CHEBI:25389) |
| cytonic acid B (CHEBI:65718) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 4-({4-[(2,4-dihydroxy-6-propylbenzoyl)oxy]-2-hydroxy-6-propylbenzoyl}oxy)-2-hydroxy-6-pentylbenzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8667710 | Reaxys |
| Citations |
|---|