EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35N5O7S |
| Net Charge | 0 |
| Average Mass | 573.672 |
| Monoisotopic Mass | 573.22572 |
| SMILES | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C27H35N5O7S/c1-40-12-11-21(27(38)39)32-26(37)22(14-17-5-3-2-4-6-17)31-24(35)16-29-23(34)15-30-25(36)20(28)13-18-7-9-19(33)10-8-18/h2-10,20-22,33H,11-16,28H2,1H3,(H,29,34)(H,30,36)(H,31,35)(H,32,37)(H,38,39)/t20-,21-,22-/m0/s1 |
| InChIKey | YFGBQHOOROIVKG-FKBYEOEOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. delta-opioid receptor agonist A compound that exhibits agonist activity at the δ-opioid receptor. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-enkephalin (CHEBI:6618) has functional parent L-methionine (CHEBI:16643) |
| Met-enkephalin (CHEBI:6618) has functional parent L-phenylalanine (CHEBI:17295) |
| Met-enkephalin (CHEBI:6618) has functional parent L-tyrosine (CHEBI:17895) |
| Met-enkephalin (CHEBI:6618) has functional parent glycine (CHEBI:15428) |
| Met-enkephalin (CHEBI:6618) has role analgesic (CHEBI:35480) |
| Met-enkephalin (CHEBI:6618) has role antineoplastic agent (CHEBI:35610) |
| Met-enkephalin (CHEBI:6618) has role human metabolite (CHEBI:77746) |
| Met-enkephalin (CHEBI:6618) has role δ-opioid receptor agonist (CHEBI:64054) |
| Met-enkephalin (CHEBI:6618) has role μ-opioid receptor agonist (CHEBI:55322) |
| Met-enkephalin (CHEBI:6618) is a pentapeptide (CHEBI:48545) |
| Met-enkephalin (CHEBI:6618) is tautomer of Met-enkephalin zwitterion (CHEBI:189868) |
| Incoming Relation(s) |
| Met-enkephalin zwitterion (CHEBI:189868) is tautomer of Met-enkephalin (CHEBI:6618) |
| IUPAC Name |
|---|
| L-tyrosylglycylglycyl-L-phenylalanyl-L-methionine |
| INNs | Source |
|---|---|
| metencefalina | WHO MedNet |
| metenkefalin | WHO MedNet |
| métenkefaline | WHO MedNet |
| metenkefalinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| MET-enkephalin | KEGG COMPOUND |
| methionine enkephalin | KEGG COMPOUND |
| H-L-Tyr-Gly-Gly-L-Phe-L-Met-OH | ChEBI |
| Tyr-Gly-Gly-Phe-Met | ChemIDplus |
| L-Tyr-Gly-Gly-L-Phe-L-Met | ChemIDplus |
| Tyr-Gly-Gly-Phe-Met-OH | ChemIDplus |
| Brand Name | Source |
|---|---|
| Lupex | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11684 | KEGG COMPOUND |
| DB12668 | DrugBank |
| 391597 | ChemSpider |
| Met-enkephalin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:58569-55-4 | ChemIDplus |
| Citations |
|---|