EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65858 - ergosterol peroxide
| Formula | C28H44O3 |
| Net Charge | 0 |
| Average Mass | 428.657 |
| Monoisotopic Mass | 428.32905 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](O)C[C@]34C=C[C@]21OO4 |
| InChI | InChI=1S/C28H44O3/c1-18(2)19(3)7-8-20(4)22-9-10-23-25(22,5)13-12-24-26(6)14-11-21(29)17-27(26)15-16-28(23,24)31-30-27/h7-8,15-16,18-24,29H,9-14,17H2,1-6H3/b8-7+/t19-,20+,21-,22+,23+,24+,25+,26+,27+,28-/m0/s1 |
| InChIKey | VXOZCESVZIRHCJ-KGHQQZOUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | fruit body (BTO:0000487) | PubMed (9635497) | |
| Cordyceps sinensis (ncbitaxon:72228) | |||
| mycelium (BTO:0001436) | PubMed (10423860) | ||
| mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia | |
| Sarcodon aspratus (ncbitaxon:155012) | - | PubMed (15665489) | |
| Xylaria (ncbitaxon:37991) | - | PubMed (21428374) | Endolichenic fungi isolated from Leptogium saturninum and EtOAc extract of fermented rice substrate |
| Pisonia aculeata (ncbitaxon:363212) | |||
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots |
| Radermachera boniana (IPNI:110489-1) | |||
| leaf (BTO:0000713) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| twig (BTO:0001411) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| Phomopsis archeri (fungorum:113952) | mycelium (BTO:0001436) | PubMed (21341709) | Endophytic fungus isolated from cortex stem of Vanilla albidia and combined Mycelial extract |
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (22112725) | |
| Chaetomium longirostre (ncbitaxon:669026) | |||
| - | PubMed (22004007) | ||
| - | PubMed (22004007) | Ethyl acetate extract of dried fungal biomass | |
| Daedalea quercina (ncbitaxon:40437) | - | PubMed (11014261) | |
| Daedaleopsis confragosa (ncbitaxon:40433) | - | PubMed (11014261) | |
| Aspergillus ochraceus (ncbitaxon:40380) | mycelium (BTO:0001436) | PubMed (21043476) | MeOH(mycelia) & EtOAc(broth) extract of an endophytic fungus isolated from Sargassum kjellmanianum Strain: EN 31 |
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Penicillium commune (ncbitaxon:36653) | mycelium (BTO:0001436) | PubMed (21226488) | Methanolic extract of mycelia and ethyl acetate extract of culture broth Strain: QSD 17 |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergosterol peroxide (CHEBI:65858) has functional parent ergosterol (CHEBI:16933) |
| ergosterol peroxide (CHEBI:65858) has role antimycobacterial drug (CHEBI:64912) |
| ergosterol peroxide (CHEBI:65858) has role antineoplastic agent (CHEBI:35610) |
| ergosterol peroxide (CHEBI:65858) has role metabolite (CHEBI:25212) |
| ergosterol peroxide (CHEBI:65858) has role trypanocidal drug (CHEBI:36335) |
| ergosterol peroxide (CHEBI:65858) is a 3β-sterol (CHEBI:35348) |
| ergosterol peroxide (CHEBI:65858) is a ergostanoid (CHEBI:50403) |
| ergosterol peroxide (CHEBI:65858) is a organic peroxide (CHEBI:25702) |
| ergosterol peroxide (CHEBI:65858) is a phytosterols (CHEBI:26125) |
| IUPAC Name |
|---|
| (3S,5S,8S,9R,10R,13R,14R,17R)-17-[(2R,3E,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,3,4,9,10,11,12,13,14,15,16,17-dodecahydro-2H-5,8-epidioxycyclopenta[a]phenanthren-3-ol |
| Synonyms | Source |
|---|---|
| (3β,5α,8α,22E)-5,8-epidioxyergosta-6,22-dien-3-ol | ChemIDplus |
| ergosterol-5,8-peroxide | ChemIDplus |
| 5α,8α-epidioxy-22E-ergosta-6,22-dien-3β-ol | ChEBI |
| peroxyergosterol | ChemIDplus |
| ergosterol 5α,8α-epidioxide | ChemIDplus |
| (22E,24R)-5α,8α-epidioxyergosta-6,22-dien-3β-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4508532 | ChemSpider |
| Ergosterol_peroxide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:96852 | Reaxys |
| CAS:2061-64-5 | ChemIDplus |
| Citations |
|---|