EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O3 |
| Net Charge | 0 |
| Average Mass | 428.657 |
| Monoisotopic Mass | 428.32905 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@H](O)C[C@]34C=C[C@]21OO4 |
| InChI | InChI=1S/C28H44O3/c1-18(2)19(3)7-8-20(4)22-9-10-23-25(22,5)13-12-24-26(6)14-11-21(29)17-27(26)15-16-28(23,24)31-30-27/h7-8,15-16,18-24,29H,9-14,17H2,1-6H3/b8-7+/t19-,20+,21-,22+,23+,24+,25+,26+,27+,28-/m0/s1 |
| InChIKey | VXOZCESVZIRHCJ-KGHQQZOUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | mycelium (BTO:0001436) | PubMed (21043476) | MeOH(mycelia) & EtOAc(broth) extract of an endophytic fungus isolated from Sargassum kjellmanianum Strain: EN 31 |
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots |
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (22112725) | |
| Chaetomium longirostre (ncbitaxon:669026) | |||
| - | PubMed (22004007) | Ethyl acetate extract of dried fungal biomass | |
| - | PubMed (22004007) | ||
| Cordyceps sinensis (ncbitaxon:72228) | |||
| mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia | |
| mycelium (BTO:0001436) | PubMed (10423860) | ||
| Daedalea quercina (ncbitaxon:40437) | - | PubMed (11014261) | |
| Daedaleopsis confragosa (ncbitaxon:40433) | - | PubMed (11014261) | |
| Ganoderma lucidum (ncbitaxon:5315) | fruit body (BTO:0000487) | PubMed (9635497) | |
| Penicillium commune (ncbitaxon:36653) | mycelium (BTO:0001436) | PubMed (21226488) | Methanolic extract of mycelia and ethyl acetate extract of culture broth Strain: QSD 17 |
| Phomopsis archeri (fungorum:113952) | mycelium (BTO:0001436) | PubMed (21341709) | Endophytic fungus isolated from cortex stem of Vanilla albidia and combined Mycelial extract |
| Pisonia aculeata (ncbitaxon:363212) | |||
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| Radermachera boniana (IPNI:110489-1) | |||
| leaf (BTO:0000713) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| twig (BTO:0001411) | PubMed (21469696) | Ethylacetate extract of dried and ground mixture of twigs and leaves | |
| Sarcodon aspratus (ncbitaxon:155012) | - | PubMed (15665489) | |
| Taiwanofungus camphoratus (ncbitaxon:196114) | fruit body (BTO:0000487) | PubMed (21028898) | Parasitic to the inner heartwood wall of old hollow trunks of Cinnamomum kanehirai, EtOH extract |
| Xylaria (ncbitaxon:37991) | - | PubMed (21428374) | Endolichenic fungi isolated from Leptogium saturninum and EtOAc extract of fermented rice substrate |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergosterol peroxide (CHEBI:65858) has functional parent ergosterol (CHEBI:16933) |
| ergosterol peroxide (CHEBI:65858) has role antimycobacterial drug (CHEBI:64912) |
| ergosterol peroxide (CHEBI:65858) has role antineoplastic agent (CHEBI:35610) |
| ergosterol peroxide (CHEBI:65858) has role metabolite (CHEBI:25212) |
| ergosterol peroxide (CHEBI:65858) has role trypanocidal drug (CHEBI:36335) |
| ergosterol peroxide (CHEBI:65858) is a 3β-sterol (CHEBI:35348) |
| ergosterol peroxide (CHEBI:65858) is a ergostanoid (CHEBI:50403) |
| ergosterol peroxide (CHEBI:65858) is a organic peroxide (CHEBI:25702) |
| ergosterol peroxide (CHEBI:65858) is a phytosterols (CHEBI:26125) |
| IUPAC Name |
|---|
| (3S,5S,8S,9R,10R,13R,14R,17R)-17-[(2R,3E,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,3,4,9,10,11,12,13,14,15,16,17-dodecahydro-2H-5,8-epidioxycyclopenta[a]phenanthren-3-ol |
| Synonyms | Source |
|---|---|
| (22E,24R)-5α,8α-epidioxyergosta-6,22-dien-3β-ol | ChEBI |
| (24R)-5α,8α-epidioxy-24-methylcholesta-6,22-dien-3β-ol | ChEBI |
| (3β,5α,8α,22E)-5,8-epidioxyergosta-6,22-dien-3-ol | ChemIDplus |
| 5α,8α-epidioxy-22E-ergosta-6,22-dien-3β-ol | ChEBI |
| ergosterol-5,8-peroxide | ChemIDplus |
| ergosterol 5α,8α-epidioxide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4508532 | ChemSpider |
| Ergosterol_peroxide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:96852 | Reaxys |
| CAS:2061-64-5 | ChemIDplus |
| Citations |
|---|