EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16933 - ergosterol
| Formula | C28H44O |
| Net Charge | 0 |
| Average Mass | 396.659 |
| Monoisotopic Mass | 396.33922 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]1(C)CC[C@@]1([H])C2=CC=C2C[C@@H](O)CC[C@@]21C |
| InChI | InChI=1S/C28H44O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,18-20,22,24-26,29H,11-17H2,1-6H3/b8-7+/t19-,20+,22-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | DNVPQKQSNYMLRS-APGDWVJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (21428374) | Endolichenic fungi isolated from Leptogium saturninum and EtOAc extract of fermented rice substrate |
| Microdiplodia (ncbitaxon:371130) | - | PubMed (21244021) | EtOAc extract of an endophytic fungi isolated from Lycium intricatum Strain: 9907 |
| Phomopsis archeri (fungorum:113952) | mycelium (BTO:0001436) | PubMed (21341709) | Endophytic fungus isolated from cortex stem of Vanilla albidia and combined Mycelial extract |
| Chaetomium arcuatum (ncbitaxon:911086) | - | CiteXplore (c6148) | |
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (12357398) | |
| Chaetomium brasiliense (ncbitaxon:155871) | - | PubMed (19663417) | |
| Chaetomium longirostre (ncbitaxon:669026) | |||
| - | PubMed (22004007) | ||
| - | PubMed (22004007) | Ethyl acetate extract of dried fungal biomass | |
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Hypocrella (ncbitaxon:42305) | mycelium (BTO:0001436) | PubMed (21995505) | Fungus was isolated from scale insect Strain: BCC 14524 |
| Aspergillus ochraceus (ncbitaxon:40380) | mycelium (BTO:0001436) | PubMed (21043476) | MeOH(mycelia) & EtOAc(broth) extract of an endophytic fungus isolated from Sargassum kjellmanianum Strain: EN 31 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ergosterol (CHEBI:16933) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| ergosterol (CHEBI:16933) has role fungal metabolite (CHEBI:76946) |
| ergosterol (CHEBI:16933) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| ergosterol (CHEBI:16933) is a 3β-sterol (CHEBI:35348) |
| ergosterol (CHEBI:16933) is a ergostanoid (CHEBI:50403) |
| ergosterol (CHEBI:16933) is a phytosterols (CHEBI:26125) |
| Incoming Relation(s) |
| 1-(ergostan-3β-yl)-L-aspartate (CHEBI:195261) has functional parent ergosterol (CHEBI:16933) |
| ergosterol peroxide (CHEBI:65858) has functional parent ergosterol (CHEBI:16933) |
| ergosteryl 3-β-D-glucoside (CHEBI:52973) has functional parent ergosterol (CHEBI:16933) |
| ergosteryl ester (CHEBI:52320) has functional parent ergosterol (CHEBI:16933) |
| xuezhikang (CHEBI:231891) has part ergosterol (CHEBI:16933) |
| (22E,24R)-5alpha,6alpha-epoxy3beta,7alpha,14beta-trihydroxy-ergosta-8,22,dien-15-one (CHEBI:231322) is a ergosterol (CHEBI:16933) |
| (22E,24R)-6alpha-methoxy-7alpha,15beta-dihydroxyergosta-4,8(14),22-triene-3-one (CHEBI:231321) is a ergosterol (CHEBI:16933) |
| IUPAC Name |
|---|
| (22E)-ergosta-5,7,22-trien-3β-ol |
| Synonyms | Source |
|---|---|
| Ergosterol | KEGG COMPOUND |
| Provitamin D2 | KEGG COMPOUND |
| (22E,24S)-24-methylcholesta-5,7,22-trien-3β-ol | JCBN |
| ERGOSTEROL | PDBeChem |
| UniProt Name | Source |
|---|---|
| ergosterol | UniProt |