EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O4 |
| Net Charge | 0 |
| Average Mass | 338.488 |
| Monoisotopic Mass | 338.24571 |
| SMILES | [H][C@@]12CC[C@@](C)(O)[C@H](CC/C(C)=C/C(=O)O)[C@@]1(C)CCC[C@@]2(C)CO |
| InChI | InChI=1S/C20H34O4/c1-14(12-17(22)23)6-7-16-19(3)10-5-9-18(2,13-21)15(19)8-11-20(16,4)24/h12,15-16,21,24H,5-11,13H2,1-4H3,(H,22,23)/b14-12+/t15-,16+,18-,19-,20+/m0/s1 |
| InChIKey | IYSBWLRXTOIYFZ-KBLZDMJYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crassocephalum mannii (IPNI:199508-1) | whole plant (BTO:0001461) | PubMed (18473477) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. cyclooxygenase 1 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 1. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8α,19-dihydroxylabd-13E-ene-15-oic acid (CHEBI:65789) has role cyclooxygenase 1 inhibitor (CHEBI:50630) |
| 8α,19-dihydroxylabd-13E-ene-15-oic acid (CHEBI:65789) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| 8α,19-dihydroxylabd-13E-ene-15-oic acid (CHEBI:65789) has role plant metabolite (CHEBI:76924) |
| 8α,19-dihydroxylabd-13E-ene-15-oic acid (CHEBI:65789) is a diol (CHEBI:23824) |
| 8α,19-dihydroxylabd-13E-ene-15-oic acid (CHEBI:65789) is a labdane diterpenoid (CHEBI:36770) |
| 8α,19-dihydroxylabd-13E-ene-15-oic acid (CHEBI:65789) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2E)-5-[(1R,2R,4aR,5R,8aS)-2-hydroxy-5-(hydroxymethyl)-2,5,8a-trimethyldecahydronaphthalen-1-yl]-3-methylpent-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24713077 | ChemSpider |
| Citations |
|---|