EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O12 |
| Net Charge | 0 |
| Average Mass | 516.455 |
| Monoisotopic Mass | 516.12678 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@H]1O |
| InChI | InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(30)36-19-11-25(35,24(33)34)12-20(23(19)32)37-22(31)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-29,32,35H,11-12H2,(H,33,34)/b7-3+,8-4+/t19-,20-,23-,25+/m1/s1 |
| InChIKey | KRZBCHWVBQOTNZ-PSEXTPKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis mellifera (ncbitaxon:7460) | - | PubMed (8951168) | Found in propolis. |
| Dichrocephala bicolor (IPNI:201282-1) | whole plant (BTO:0001461) | DOI (10.1021/np980153o) | |
| Phagnalon rupestre (ncbitaxon:943712) | aerial part (BTO:0001658) | PubMed (21469692) | Ethyl acetate soluble fraction from methanolic extract of aerial parts |
| Solidago virgaaurea var. gigantea (ncbitaxon:462879) | aerial part (BTO:0001658) | PubMed (15022716) | |
| Suaeda glauca (ncbitaxon:397272) | whole plant (BTO:0001461) | PubMed (18481014) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) has functional parent (−)-quinic acid (CHEBI:17521) |
| 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) has functional parent trans-caffeic acid (CHEBI:16433) |
| 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) has role antineoplastic agent (CHEBI:35610) |
| 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) has role hepatoprotective agent (CHEBI:62868) |
| 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) has role metabolite (CHEBI:25212) |
| 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) is a carboxylic ester (CHEBI:33308) |
| 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) is a cyclitol carboxylic acid (CHEBI:36123) |
| 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) is conjugate acid of 3,5-di-O-caffeoyl quinate (CHEBI:231591) |
| Incoming Relation(s) |
| methyl 3,5-di-O-caffeoyl quinate (CHEBI:66708) has functional parent 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) |
| 3,5-di-O-caffeoyl quinate (CHEBI:231591) is conjugate base of 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) |
| IUPAC Name |
|---|
| (3R,5R)-3,5-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4-dihydroxycyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| (1S,3R,4S,5R)-1,3,4,5-tetrahydroxy-1-carboxycyclohexane3,5-di-3-(3,4-dihydroxyphenyl)propenoate | ChEBI |
| 3,5-DCQA | HMDB |
| 3,5-Dicaffeoylquinic acid | HMDB |
| Isochlorogenic acid a | HMDB |
| Quinic acid 3,5-di-O-caffeate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030706 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4895191 | Reaxys |
| Citations |
|---|