EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26O12 |
| Net Charge | 0 |
| Average Mass | 530.482 |
| Monoisotopic Mass | 530.14243 |
| SMILES | COC(=O)[C@]1(O)C[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@@H](O)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C26H26O12/c1-36-25(34)26(35)12-20(37-22(31)8-4-14-2-6-16(27)18(29)10-14)24(33)21(13-26)38-23(32)9-5-15-3-7-17(28)19(30)11-15/h2-11,20-21,24,27-30,33,35H,12-13H2,1H3/b8-4+,9-5+/t20-,21-,24-,26+/m1/s1 |
| InChIKey | VEBNYMXKXIIGFX-VOHNXBSUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solidago virgaaurea var. gigantea (ncbitaxon:462879) | aerial part (BTO:0001658) | PubMed (15022716) | |
| Suaeda glauca (ncbitaxon:397272) | whole plant (BTO:0001461) | PubMed (18481014) | |
| Dichrocephala bicolor (IPNI:201282-1) | whole plant (BTO:0001461) | DOI (10.1021/np980153o) | |
| Phagnalon rupestre (ncbitaxon:943712) | aerial part (BTO:0001658) | PubMed (21469692) | Ethyl acetate soluble fraction from methanolic extract of aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 3,5-di-O-caffeoyl quinate (CHEBI:66708) has functional parent 3,5-di-O-caffeoyl quinic acid (CHEBI:65751) |
| methyl 3,5-di-O-caffeoyl quinate (CHEBI:66708) has role hepatoprotective agent (CHEBI:62868) |
| methyl 3,5-di-O-caffeoyl quinate (CHEBI:66708) has role metabolite (CHEBI:25212) |
| methyl 3,5-di-O-caffeoyl quinate (CHEBI:66708) is a catechols (CHEBI:33566) |
| methyl 3,5-di-O-caffeoyl quinate (CHEBI:66708) is a cinnamate ester (CHEBI:36087) |
| methyl 3,5-di-O-caffeoyl quinate (CHEBI:66708) is a methyl ester (CHEBI:25248) |
| methyl 3,5-di-O-caffeoyl quinate (CHEBI:66708) is a secondary alcohol (CHEBI:35681) |
| methyl 3,5-di-O-caffeoyl quinate (CHEBI:66708) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| methyl (3R,5R)-3,5-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1,4-dihydroxycyclohexanecarboxylate |
| Manual Xrefs | Databases |
|---|---|
| 24692051 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9172717 | Reaxys |
| Citations |
|---|