EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | [H][C@@]1(C(=C)C)CC(C)(C)[C@@]([H])(c2c(O)cc3oc4c(O)c(O)ccc4c(=O)c3c2O)C1 |
| InChI | InChI=1S/C23H24O6/c1-10(2)11-7-13(23(3,4)9-11)17-15(25)8-16-18(21(17)28)19(26)12-5-6-14(24)20(27)22(12)29-16/h5-6,8,11,13,24-25,27-28H,1,7,9H2,2-4H3/t11-,13+/m0/s1 |
| InChIKey | LYMUFMGSOHLCHO-WCQYABFASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum styphelioides (IPNI:433886-1) | leaf (BTO:0000713) | PubMed (15165152) | |
| Hypericum roeperianum (ncbitaxon:269018) | root (BTO:0001188) | PubMed (8862040) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-O-demethylpaxanthonin (CHEBI:65742) has functional parent paxanthonin (CHEBI:71520) |
| 5-O-demethylpaxanthonin (CHEBI:65742) has role antifungal agent (CHEBI:35718) |
| 5-O-demethylpaxanthonin (CHEBI:65742) has role antioxidant (CHEBI:22586) |
| 5-O-demethylpaxanthonin (CHEBI:65742) has role metabolite (CHEBI:25212) |
| 5-O-demethylpaxanthonin (CHEBI:65742) is a polyphenol (CHEBI:26195) |
| 5-O-demethylpaxanthonin (CHEBI:65742) is a xanthones (CHEBI:51149) |
| Incoming Relation(s) |
| 1,3,5-trihydroxy-2-(2',2'-dimethyl-4'-isopropenyl)cyclopentanylxanthone (CHEBI:66053) has functional parent 5-O-demethylpaxanthonin (CHEBI:65742) |
| IUPAC Name |
|---|
| 2-[(1S,4S)-2,2-dimethyl-4-(prop-1-en-2-yl)cyclopentyl]-1,3,5,6-tetrahydroxy-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,3,5,6-tetrahydroxy-2-(2',2'-dimethyl-4'-isopropenyl)-cyclopentanylxanthone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 13100107 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7665231 | Reaxys |
| Citations |
|---|