EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O6 |
| Net Charge | 0 |
| Average Mass | 410.466 |
| Monoisotopic Mass | 410.17294 |
| SMILES | [H][C@@]1(C(=C)C)CC(C)(C)[C@@]([H])(c2c(O)cc3oc4c(OC)c(O)ccc4c(=O)c3c2O)C1 |
| InChI | InChI=1S/C24H26O6/c1-11(2)12-8-14(24(3,4)10-12)18-16(26)9-17-19(21(18)28)20(27)13-6-7-15(25)23(29-5)22(13)30-17/h6-7,9,12,14,25-26,28H,1,8,10H2,2-5H3/t12-,14+/m0/s1 |
| InChIKey | GYBUSKWANOPNPI-GXTWGEPZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum perforatum (ncbitaxon:65561) | callus (BTO:0001010) | PubMed (15715262) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paxanthonin (CHEBI:71520) has role antimicrobial agent (CHEBI:33281) |
| paxanthonin (CHEBI:71520) has role plant metabolite (CHEBI:76924) |
| paxanthonin (CHEBI:71520) has role radical scavenger (CHEBI:48578) |
| paxanthonin (CHEBI:71520) is a aromatic ether (CHEBI:35618) |
| paxanthonin (CHEBI:71520) is a polyphenol (CHEBI:26195) |
| paxanthonin (CHEBI:71520) is a xanthones (CHEBI:51149) |
| Incoming Relation(s) |
| 5-O-demethylpaxanthonin (CHEBI:65742) has functional parent paxanthonin (CHEBI:71520) |
| IUPAC Name |
|---|
| 2-[(1S,4S)-2,2-dimethyl-4-(prop-1-en-2-yl)cyclopentyl]-1,3,6-trihydroxy-5-methoxy-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7394169 | Reaxys |
| Citations |
|---|