EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O5 |
| Net Charge | 0 |
| Average Mass | 380.440 |
| Monoisotopic Mass | 380.16237 |
| SMILES | [H][C@@]1(C(=C)C)CC(C)(C)[C@@]([H])(c2c(O)cc3oc4c(O)cccc4c(=O)c3c2O)C1 |
| InChI | InChI=1S/C23H24O5/c1-11(2)12-8-14(23(3,4)10-12)18-16(25)9-17-19(21(18)27)20(26)13-6-5-7-15(24)22(13)28-17/h5-7,9,12,14,24-25,27H,1,8,10H2,2-4H3/t12-,14+/m0/s1 |
| InChIKey | AUUIZUXRGRVPCU-GXTWGEPZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum styphelioides (IPNI:433886-1) | leaf (BTO:0000713) | PubMed (15165152) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,5-trihydroxy-2-(2',2'-dimethyl-4'-isopropenyl)cyclopentanylxanthone (CHEBI:66053) has functional parent 5-O-demethylpaxanthonin (CHEBI:65742) |
| 1,3,5-trihydroxy-2-(2',2'-dimethyl-4'-isopropenyl)cyclopentanylxanthone (CHEBI:66053) has role antioxidant (CHEBI:22586) |
| 1,3,5-trihydroxy-2-(2',2'-dimethyl-4'-isopropenyl)cyclopentanylxanthone (CHEBI:66053) has role metabolite (CHEBI:25212) |
| 1,3,5-trihydroxy-2-(2',2'-dimethyl-4'-isopropenyl)cyclopentanylxanthone (CHEBI:66053) is a phenols (CHEBI:33853) |
| 1,3,5-trihydroxy-2-(2',2'-dimethyl-4'-isopropenyl)cyclopentanylxanthone (CHEBI:66053) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 2-[(1S,4S)-2,2-dimethyl-4-(prop-1-en-2-yl)cyclopentyl]-1,3,5-trihydroxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 6-deoxy-5-O-demethylpaxanthonin | ChEBI |
| Hypericum xanthone | ChEBI |
| Citations |
|---|