EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35N5O5 |
| Net Charge | 0 |
| Average Mass | 473.574 |
| Monoisotopic Mass | 473.26382 |
| SMILES | [H][C@@]1(C(=O)NCc2ccc(C(N)=NO)cc2)CCN1C(=O)[C@H](NCC(=O)OCC)C1CCCCC1 |
| InChI | InChI=1S/C24H35N5O5/c1-2-34-20(30)15-26-21(17-6-4-3-5-7-17)24(32)29-13-12-19(29)23(31)27-14-16-8-10-18(11-9-16)22(25)28-33/h8-11,17,19,21,26,33H,2-7,12-15H2,1H3,(H2,25,28)(H,27,31)/t19-,21+/m0/s1 |
| InChIKey | ZXIBCJHYVWYIKI-PZJWPPBQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. EC 3.4.21.5 (thrombin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of thrombin (EC 3.4.21.5). |
| Applications: | anticoagulant An agent that prevents blood clotting. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ximelagatran (CHEBI:65172) has functional parent melagatran (CHEBI:43966) |
| ximelagatran (CHEBI:65172) has role anticoagulant (CHEBI:50249) |
| ximelagatran (CHEBI:65172) has role EC 3.4.21.5 (thrombin) inhibitor (CHEBI:65232) |
| ximelagatran (CHEBI:65172) has role prodrug (CHEBI:50266) |
| ximelagatran (CHEBI:65172) has role serine protease inhibitor (CHEBI:64926) |
| ximelagatran (CHEBI:65172) is a amidoxime (CHEBI:65234) |
| ximelagatran (CHEBI:65172) is a azetidines (CHEBI:38777) |
| ximelagatran (CHEBI:65172) is a carboxamide (CHEBI:37622) |
| ximelagatran (CHEBI:65172) is a ethyl ester (CHEBI:23990) |
| ximelagatran (CHEBI:65172) is a secondary amino compound (CHEBI:50995) |
| ximelagatran (CHEBI:65172) is a secondary carboxamide (CHEBI:140325) |
| ximelagatran (CHEBI:65172) is a tertiary carboxamide (CHEBI:140326) |
| ximelagatran (CHEBI:65172) is tautomer of ximelagatran (hydroxylamine form) (CHEBI:136702) |
| Incoming Relation(s) |
| ximelagatran (hydroxylamine form) (CHEBI:136702) is tautomer of ximelagatran (CHEBI:65172) |
| IUPAC Name |
|---|
| ethyl N-{(1R)-1-cyclohexyl-2-[(2S)-2-{[4-(N'-hydroxycarbamimidoyl)benzyl]carbamoyl}azetidin-1-yl]-2-oxoethyl}glycinate |
| INNs | Source |
|---|---|
| ximelagatran | WHO MedNet |
| ximelagatrán | WHO MedNet |
| ximélagatran | WHO MedNet |
| ximelagatranum | WHO MedNet |
| Synonyms | Source |
|---|---|
| ethyl 2-[[(1R)-1-cyclohexyl-2- [(2S)-2-[[4-(N'-hydroxycarbamimidoyl) phenyl]methylcarbamoyl]azetidin-1-yl]- 2-oxo-ethyl]amino]acetate | ChEBI |
| Exanta | SUBMITTER |
| Exarta | SUBMITTER |
| H 376-95 | ChemIDplus |
| H 376/95 | ChemIDplus |
| H 37695 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2852 | DrugCentral |
| D01981 | KEGG DRUG |
| DB04898 | DrugBank |
| Ximelagatran | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14559655 | Reaxys |
| CAS:192939-46-1 | KEGG DRUG |
| CAS:192939-46-1 | ChemIDplus |
| Citations |
|---|