EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N5O4 |
| Net Charge | 0 |
| Average Mass | 429.521 |
| Monoisotopic Mass | 429.23760 |
| SMILES | [H][C@@]1(C(=O)NCc2ccc(C(=N)N)cc2)CCN1C(=O)[C@H](NCC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C22H31N5O4/c23-20(24)16-8-6-14(7-9-16)12-26-21(30)17-10-11-27(17)22(31)19(25-13-18(28)29)15-4-2-1-3-5-15/h6-9,15,17,19,25H,1-5,10-13H2,(H3,23,24)(H,26,30)(H,28,29)/t17-,19+/m0/s1 |
| InChIKey | DKWNMCUOEDMMIN-PKOBYXMFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.4.21.5 (thrombin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of thrombin (EC 3.4.21.5). serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| melagatran (CHEBI:43966) has role anticoagulant (CHEBI:50249) |
| melagatran (CHEBI:43966) has role EC 3.4.21.5 (thrombin) inhibitor (CHEBI:65232) |
| melagatran (CHEBI:43966) has role serine protease inhibitor (CHEBI:64926) |
| melagatran (CHEBI:43966) is a azetidines (CHEBI:38777) |
| melagatran (CHEBI:43966) is a carboxamidine (CHEBI:35359) |
| melagatran (CHEBI:43966) is a dicarboxylic acid monoamide (CHEBI:35735) |
| melagatran (CHEBI:43966) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| melagatran (CHEBI:43966) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| ximelagatran (CHEBI:65172) has functional parent melagatran (CHEBI:43966) |
| IUPAC Name |
|---|
| N-[(1R)-2-{(2S)-2-[(4-carbamimidoylbenzyl)carbamoyl]azetidin-1-yl}-1-cyclohexyl-2-oxoethyl]glycine |
| INNs | Source |
|---|---|
| mélagatran | WHO MedNet |
| melagatran | ChemIDplus |
| melagatrán | WHO MedNet |
| melagatranum | WHO MedNet |
| Synonym | Source |
|---|---|
| N-((R)-(((2S)-2-((-p-amidobenzyl)carbamoyl)-1-azetidinyl)carbonyl)cyclohexylmethyl)glycine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8090770 | Reaxys |
| CAS:159776-70-2 | ChemIDplus |
| CAS:159776-70-2 | KEGG DRUG |
| Citations |
|---|