EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35N5O5 |
| Net Charge | 0 |
| Average Mass | 473.574 |
| Monoisotopic Mass | 473.26382 |
| SMILES | [H][C@@]1(C(=O)NCc2ccc(C(=N)NO)cc2)CCN1C(=O)[C@H](NCC(=O)OCC)C1CCCCC1 |
| InChI | InChI=1S/C24H35N5O5/c1-2-34-20(30)15-26-21(17-6-4-3-5-7-17)24(32)29-13-12-19(29)23(31)27-14-16-8-10-18(11-9-16)22(25)28-33/h8-11,17,19,21,26,33H,2-7,12-15H2,1H3,(H2,25,28)(H,27,31)/t19-,21+/m0/s1 |
| InChIKey | ZXIBCJHYVWYIKI-PZJWPPBQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ximelagatran (hydroxylamine form) (CHEBI:136702) is a azetidines (CHEBI:38777) |
| ximelagatran (hydroxylamine form) (CHEBI:136702) is a ethyl ester (CHEBI:23990) |
| ximelagatran (hydroxylamine form) (CHEBI:136702) is a hydroxylamines (CHEBI:24709) |
| ximelagatran (hydroxylamine form) (CHEBI:136702) is a secondary carboxamide (CHEBI:140325) |
| ximelagatran (hydroxylamine form) (CHEBI:136702) is a tertiary carboxamide (CHEBI:140326) |
| ximelagatran (hydroxylamine form) (CHEBI:136702) is tautomer of ximelagatran (CHEBI:65172) |
| Incoming Relation(s) |
| ximelagatran (CHEBI:65172) is tautomer of ximelagatran (hydroxylamine form) (CHEBI:136702) |
| IUPAC Name |
|---|
| ethyl ({(1R)-1-cyclohexyl-2-[(2S)-2-({[4-(N-hydroxycarbamimidoyl)phenyl]methyl}carbamoyl)azetidin-1-yl]-2-oxoethyl}amino)acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9741940 | Reaxys |
| Citations |
|---|