EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26N2O8 |
| Net Charge | +2 |
| Average Mass | 326.346 |
| Monoisotopic Mass | 326.16782 |
| SMILES | [NH3+][C@@H]1C[C@H]([NH3+])[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H24N2O8/c13-3-1-4(14)11(9(19)6(3)16)22-12-10(20)8(18)7(17)5(2-15)21-12/h3-12,15-20H,1-2,13-14H2/p+2/t3-,4+,5-,6+,7-,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | KXYGCYIEINSYLN-JCLMPDJQSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deamino-2'-hydroxyparomamine(2+) (CHEBI:65071) is a ammonium ion derivative (CHEBI:35274) |
| 2'-deamino-2'-hydroxyparomamine(2+) (CHEBI:65071) is a organic cation (CHEBI:25697) |
| 2'-deamino-2'-hydroxyparomamine(2+) (CHEBI:65071) is conjugate acid of 2'-deamino-2'-hydroxyparomamine (CHEBI:65075) |
| Incoming Relation(s) |
| 2'-deamino-2'-hydroxyparomamine (CHEBI:65075) is conjugate base of 2'-deamino-2'-hydroxyparomamine(2+) (CHEBI:65071) |
| IUPAC Name |
|---|
| (1R,3S,4R,5R,6S)-4-(α-D-glucopyranosyloxy)-5,6-dihydroxycyclohexane-1,3-diaminium |
| Synonyms | Source |
|---|---|
| 2'-deamino-2'-hydroxyparomaminium(2+) | ChEBI |
| 2'-deamino-2'-hydroxyparomaminium dication | ChEBI |
| UniProt Name | Source |
|---|---|
| 2'-deamino-2'-hydroxyparomamine | UniProt |
| Citations |
|---|