EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | Cc1cc(O)cc2oc(=O)c3c(O)cc(O)cc3c12 |
| InChI | InChI=1S/C14H10O5/c1-6-2-7(15)5-11-12(6)9-3-8(16)4-10(17)13(9)14(18)19-11/h2-5,15-17H,1H3 |
| InChIKey | CEBXXEKPIIDJHL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alternariol (CHEBI:64983) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| alternariol (CHEBI:64983) has role metabolite (CHEBI:25212) |
| alternariol (CHEBI:64983) has role mycotoxin (CHEBI:25442) |
| alternariol (CHEBI:64983) is a benzochromenone (CHEBI:64986) |
| alternariol (CHEBI:64983) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| alternariol hapten ALa (CHEBI:189402) has functional parent alternariol (CHEBI:64983) |
| alternariol hapten ALb (CHEBI:189404) has functional parent alternariol (CHEBI:64983) |
| djalonensone (CHEBI:141315) has functional parent alternariol (CHEBI:64983) |
| IUPAC Name |
|---|
| 3,7,9-trihydroxy-1-methyl-6H-benzo[c]chromen-6-one |
| Synonyms | Source |
|---|---|
| 3,4,4'-trihydroxy-6'-methyl-2-biphenylcarboxylic acid γ-lactone | ChemIDplus |
| 3,4',5-trihydroxy-6'-methyldibenzo-α-pyrone | ChEBI |
| 3,7,9-trihydroxy-1-methyl-6H-dibenzo[b,d]pyran-6-one | IUPAC |
| AOH | ChemIDplus |
| UniProt Name | Source |
|---|---|
| alternariol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Alternariol | Wikipedia |
| C00023663 | KNApSAcK |
| C00023664 | KNApSAcK |
| C16838 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:244839 | Reaxys |
| CAS:641-38-3 | ChemIDplus |
| CAS:641-38-3 | KEGG COMPOUND |
| Citations |
|---|