EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | Cc1cc(O)cc2oc(=O)c3c(O)cc(O)cc3c12 |
| InChI | InChI=1S/C14H10O5/c1-6-2-7(15)5-11-12(6)9-3-8(16)4-10(17)13(9)14(18)19-11/h2-5,15-17H,1H3 |
| InChIKey | CEBXXEKPIIDJHL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alternariol (CHEBI:64983) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| alternariol (CHEBI:64983) has role metabolite (CHEBI:25212) |
| alternariol (CHEBI:64983) has role mycotoxin (CHEBI:25442) |
| alternariol (CHEBI:64983) is a benzochromenone (CHEBI:64986) |
| alternariol (CHEBI:64983) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| alternariol hapten ALa (CHEBI:189402) has functional parent alternariol (CHEBI:64983) |
| alternariol hapten ALb (CHEBI:189404) has functional parent alternariol (CHEBI:64983) |
| djalonensone (CHEBI:141315) has functional parent alternariol (CHEBI:64983) |
| IUPAC Name |
|---|
| 3,7,9-trihydroxy-1-methyl-6H-benzo[c]chromen-6-one |
| Synonyms | Source |
|---|---|
| 3,4,4'-trihydroxy-6'-methyl-2-biphenylcarboxylic acid γ-lactone | ChemIDplus |
| 3,4',5-trihydroxy-6'-methyldibenzo-α-pyrone | ChEBI |
| AOH | ChemIDplus |
| 3,7,9-trihydroxy-1-methyl-6H-dibenzo[b,d]pyran-6-one | IUPAC |
| UniProt Name | Source |
|---|---|
| alternariol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C16838 | KEGG COMPOUND |
| Alternariol | Wikipedia |
| C00023663 | KNApSAcK |
| C00023664 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:244839 | Reaxys |
| CAS:641-38-3 | ChemIDplus |
| CAS:641-38-3 | KEGG COMPOUND |
| Citations |
|---|