EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | COc1cc(O)c2c(=O)oc3cc(O)cc(C)c3c2c1 |
| InChI | InChI=1S/C15H12O5/c1-7-3-8(16)4-12-13(7)10-5-9(19-2)6-11(17)14(10)15(18)20-12/h3-6,16-17H,1-2H3 |
| InChIKey | LCSDQFNUYFTXMT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (12357398) | |
| Phoma sp. WF4 (ncbitaxon:1436879) | - | PubMed (26539183) | endophytes islated from finger millet (Eleusie coracana) |
| Alternaria sp. (ncbitaxon:1715220) | - | PubMed (34941720) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. mycotoxin Poisonous substance produced by fungi. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| djalonensone (CHEBI:141315) has functional parent alternariol (CHEBI:64983) |
| djalonensone (CHEBI:141315) has role antifungal agent (CHEBI:35718) |
| djalonensone (CHEBI:141315) has role fungal metabolite (CHEBI:76946) |
| djalonensone (CHEBI:141315) has role mycotoxin (CHEBI:25442) |
| djalonensone (CHEBI:141315) is a aromatic ether (CHEBI:35618) |
| djalonensone (CHEBI:141315) is a benzochromenone (CHEBI:64986) |
| IUPAC Name |
|---|
| 3,7-dihydroxy-9-methoxy-1-methyl-6H-benzo[c]chromen-6-one |
| Synonyms | Source |
|---|---|
| alternariol monomethyl ether | ChemIDplus |
| 3,7-dihydroxy-9-methoxy-1-methyl-6H-dibenzo(b,d)pyran-6-one | ChemIDplus |
| alternariol-9-methyl ether | ChemIDplus |
| AME | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:23452-05-3 | ChemIDplus |
| Citations |
|---|