EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | COc1cc(O)c2c(=O)oc3cc(O)cc(C)c3c2c1 |
| InChI | InChI=1S/C15H12O5/c1-7-3-8(16)4-12-13(7)10-5-9(19-2)6-11(17)14(10)15(18)20-12/h3-6,16-17H,1-2H3 |
| InChIKey | LCSDQFNUYFTXMT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria sp. (ncbitaxon:1715220) | - | PubMed (34941720) | |
| Chaetomium globosum (ncbitaxon:38033) | - | PubMed (12357398) | |
| Phoma sp. WF4 (ncbitaxon:1436879) | - | PubMed (26539183) | endophytes islated from finger millet (Eleusie coracana) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. mycotoxin Poisonous substance produced by fungi. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| djalonensone (CHEBI:141315) has functional parent alternariol (CHEBI:64983) |
| djalonensone (CHEBI:141315) has role antifungal agent (CHEBI:35718) |
| djalonensone (CHEBI:141315) has role fungal metabolite (CHEBI:76946) |
| djalonensone (CHEBI:141315) has role mycotoxin (CHEBI:25442) |
| djalonensone (CHEBI:141315) is a aromatic ether (CHEBI:35618) |
| djalonensone (CHEBI:141315) is a benzochromenone (CHEBI:64986) |
| IUPAC Name |
|---|
| 3,7-dihydroxy-9-methoxy-1-methyl-6H-benzo[c]chromen-6-one |
| Synonyms | Source |
|---|---|
| 3,7-dihydroxy-9-methoxy-1-methyl-6H-dibenzo(b,d)pyran-6-one | ChemIDplus |
| alternariol-9-methyl ether | ChemIDplus |
| alternariol monomethyl ether | ChemIDplus |
| AME | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:23452-05-3 | ChemIDplus |
| Citations |
|---|