EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O7 |
| Net Charge | 0 |
| Average Mass | 358.346 |
| Monoisotopic Mass | 358.10525 |
| SMILES | Cc1cc(OCCCCC(=O)O)cc2oc(=O)c3c(O)cc(O)cc3c12 |
| InChI | InChI=1S/C19H18O7/c1-10-6-12(25-5-3-2-4-16(22)23)9-15-17(10)13-7-11(20)8-14(21)18(13)19(24)26-15/h6-9,20-21H,2-5H2,1H3,(H,22,23) |
| InChIKey | HTQJBGQAMDREQL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alternariol hapten ALb (CHEBI:189404) has functional parent alternariol (CHEBI:64983) |
| alternariol hapten ALb (CHEBI:189404) has role hapten (CHEBI:59174) |
| alternariol hapten ALb (CHEBI:189404) is a alternariol hapten (CHEBI:189403) |
| alternariol hapten ALb (CHEBI:189404) is a benzochromenone (CHEBI:64986) |
| alternariol hapten ALb (CHEBI:189404) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 5-[(7,9-dihydroxy-1-methyl-6-oxo-6H-benzo[c]chromen-3-yl)oxy]pentanoic acid |
| Synonym | Source |
|---|---|
| 5-[(7,9-dihydroxy-1-methyl-6-oxo-6H-dibenzo[b,d]pyran-3-yl)oxy]pentanoic acid | IUPAC |
| Citations |
|---|