EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4O5 |
| Net Charge | -2 |
| Average Mass | 156.093 |
| Monoisotopic Mass | 156.00697 |
| SMILES | [H]C(=CC(=O)C(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/p-2 |
| InChIKey | QTHJXLFFFTVYJC-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxohex-3-enedioate (CHEBI:64928) is a oxo dicarboxylate (CHEBI:36147) |
| 2-oxohex-3-enedioate (CHEBI:64928) is conjugate base of 2-oxohex-3-enedioic acid (CHEBI:64927) |
| Incoming Relation(s) |
| (3E)-2-oxohex-3-enedioate (CHEBI:64908) is a 2-oxohex-3-enedioate (CHEBI:64928) |
| (3Z)-2-oxohex-3-enedioate (CHEBI:64011) is a 2-oxohex-3-enedioate (CHEBI:64928) |
| 2-oxohex-3-enedioic acid (CHEBI:64927) is conjugate acid of 2-oxohex-3-enedioate (CHEBI:64928) |
| IUPAC Name |
|---|
| 2-oxohex-3-enedioate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21018127 | Reaxys |