EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O5 |
| Net Charge | 0 |
| Average Mass | 158.109 |
| Monoisotopic Mass | 158.02152 |
| SMILES | [H]C(=CC(=O)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11) |
| InChIKey | QTHJXLFFFTVYJC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxohex-3-enedioic acid (CHEBI:64927) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-oxohex-3-enedioic acid (CHEBI:64927) is conjugate acid of 2-oxohex-3-enedioate (CHEBI:64928) |
| Incoming Relation(s) |
| (3E)-2-oxohex-3-enedioic acid (CHEBI:64031) is a 2-oxohex-3-enedioic acid (CHEBI:64927) |
| (3Z)-2-oxohex-3-enedioic acid (CHEBI:64038) is a 2-oxohex-3-enedioic acid (CHEBI:64927) |
| 2-oxohex-3-enedioate (CHEBI:64928) is conjugate base of 2-oxohex-3-enedioic acid (CHEBI:64927) |
| Synonyms | Source |
|---|---|
| 4-oxalocrotonic acid | ChEBI |
| γ-oxalocrotonic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:31540-68-8 | ChemIDplus |