EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4O5 |
| Net Charge | -2 |
| Average Mass | 156.093 |
| Monoisotopic Mass | 156.00697 |
| SMILES | O=C([O-])C/C=C/C(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/p-2/b2-1+ |
| InChIKey | QTHJXLFFFTVYJC-OWOJBTEDSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-2-oxohex-3-enedioate (CHEBI:64908) is a 2-oxohex-3-enedioate (CHEBI:64928) |
| (3E)-2-oxohex-3-enedioate (CHEBI:64908) is conjugate base of (3E)-2-oxohex-3-enedioic acid (CHEBI:64031) |
| Incoming Relation(s) |
| (3E)-2-oxohex-3-enedioic acid (CHEBI:64031) is conjugate acid of (3E)-2-oxohex-3-enedioate (CHEBI:64908) |
| IUPAC Name |
|---|
| (3E)-2-oxohex-3-enedioate |
| UniProt Name | Source |
|---|---|
| (3E)-2-oxohex-3-enedioate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8742 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4310323 | Reaxys |
| Citations |
|---|