EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O5 |
| Net Charge | 0 |
| Average Mass | 158.109 |
| Monoisotopic Mass | 158.02152 |
| SMILES | O=C(O)C/C=C/C(=O)C(=O)O |
| InChI | InChI=1S/C6H6O5/c7-4(6(10)11)2-1-3-5(8)9/h1-2H,3H2,(H,8,9)(H,10,11)/b2-1+ |
| InChIKey | QTHJXLFFFTVYJC-OWOJBTEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3E)-2-oxohex-3-enedioic acid (CHEBI:64031) is a 2-oxohex-3-enedioic acid (CHEBI:64927) |
| (3E)-2-oxohex-3-enedioic acid (CHEBI:64031) is conjugate acid of (3E)-2-oxohex-3-enedioate (CHEBI:64908) |
| Incoming Relation(s) |
| (3E)-2-oxohex-3-enedioate (CHEBI:64908) is conjugate base of (3E)-2-oxohex-3-enedioic acid (CHEBI:64031) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6135549 | Reaxys |
| Citations |
|---|