EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:64729 - glutathioselenol
| Formula | C10H17N3O6SSe |
| Net Charge | 0 |
| Average Mass | 386.288 |
| Monoisotopic Mass | 387.00033 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS[SeH])C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6SSe/c11-5(10(18)19)1-2-7(14)13-6(4-20-21)9(17)12-3-8(15)16/h5-6,21H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | UUYVRXVWXDDDGX-WDSKDSINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutathioselenol (CHEBI:64729) has part selenol group (CHEBI:29775) |
| glutathioselenol (CHEBI:64729) has role Escherichia coli metabolite (CHEBI:76971) |
| glutathioselenol (CHEBI:64729) has role metabolite (CHEBI:25212) |
| glutathioselenol (CHEBI:64729) is a glutathione derivative (CHEBI:24337) |
| glutathioselenol (CHEBI:64729) is a thioselenide (CHEBI:64726) |
| glutathioselenol (CHEBI:64729) is conjugate acid of glutathioselenol(1−) (CHEBI:71265) |
| Incoming Relation(s) |
| selenodiglutathione (CHEBI:26634) has functional parent glutathioselenol (CHEBI:64729) |
| glutathioselenol(1−) (CHEBI:71265) is conjugate base of glutathioselenol (CHEBI:64729) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-selanyl-L-cysteinylglycine |
| Synonym | Source |
|---|---|
| GSSeH | KEGG COMPOUND |
| Citations |
|---|