EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32N6O12S2Se |
| Net Charge | 0 |
| Average Mass | 691.600 |
| Monoisotopic Mass | 692.06848 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS[Se]SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H32N6O12S2Se/c21-9(19(35)36)1-3-13(27)25-11(17(33)23-5-15(29)30)7-39-41-40-8-12(18(34)24-6-16(31)32)26-14(28)4-2-10(22)20(37)38/h9-12H,1-8,21-22H2,(H,23,33)(H,24,34)(H,25,27)(H,26,28)(H,29,30)(H,31,32)(H,35,36)(H,37,38)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | GJEZZQVPWMCGSB-BJDJZHNGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selenodiglutathione (CHEBI:26634) has functional parent glutathioselenol (CHEBI:64729) |
| selenodiglutathione (CHEBI:26634) has role Escherichia coli metabolite (CHEBI:76971) |
| selenodiglutathione (CHEBI:26634) has role metabolite (CHEBI:25212) |
| selenodiglutathione (CHEBI:26634) is a glutathione derivative (CHEBI:24337) |
| selenodiglutathione (CHEBI:26634) is a thioselenide (CHEBI:64726) |
| selenodiglutathione (CHEBI:26634) is conjugate acid of selenodiglutathione(2−) (CHEBI:71259) |
| Incoming Relation(s) |
| selenodiglutathione(2−) (CHEBI:71259) is conjugate base of selenodiglutathione (CHEBI:26634) |
| Synonyms | Source |
|---|---|
| N,N'-((selenodithio)bis(1-((carboxymethyl)carbamoyl)ethylene))di-L-glutamine | ChEBI |
| N,N'-[(selenodithio)bis{1-[(carboxymethyl)carbamoyl]ethylene}]di-L-glutamine | ChEBI |
| GS-Se-SG | ChEBI |
| GSSeSG | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13876743 | Reaxys |
| CAS:33944-90-0 | ChemIDplus |
| Citations |
|---|