EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N3O6SSe |
| Net Charge | -1 |
| Average Mass | 385.280 |
| Monoisotopic Mass | 385.99305 |
| SMILES | [NH3+][C@@H](CCC(=O)N[C@@H](CS[SeH])C(=O)NCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H17N3O6SSe/c11-5(10(18)19)1-2-7(14)13-6(4-20-21)9(17)12-3-8(15)16/h5-6,21H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/p-1/t5-,6-/m0/s1 |
| InChIKey | UUYVRXVWXDDDGX-WDSKDSINSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutathioselenol(1−) (CHEBI:71265) is a carboxylic acid anion (CHEBI:29067) |
| glutathioselenol(1−) (CHEBI:71265) is conjugate base of glutathioselenol (CHEBI:64729) |
| Incoming Relation(s) |
| glutathioselenol (CHEBI:64729) is conjugate acid of glutathioselenol(1−) (CHEBI:71265) |
| IUPAC Name |
|---|
| (2S)-2-ammonio-5-{[(2R)-1-[(carboxylatomethyl)amino]-1-oxo-3-(selanylsulfanyl)propan-2-yl]amino}-5-oxopentanoate |
| Synonym | Source |
|---|---|
| L-γ-glutamyl-S-selanyl-L-cysteinylglycine(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| glutathioselenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13909 | MetaCyc |
| Citations |
|---|