EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C6H9N3O3 |
| Net Charge | +1 |
| Average Mass | 172.164 |
| Monoisotopic Mass | 172.07167 |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCO.[H+] |
| InChI | InChI=1S/C6H9N3O3/c1-5-7-4-6(9(11)12)8(5)2-3-10/h4,10H,2-3H2,1H3/p+1 |
| InChIKey | VAOCPAMSLUNLGC-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metronidazole(1+) (CHEBI:64682) is a organic cation (CHEBI:25697) |
| metronidazole(1+) (CHEBI:64682) is conjugate acid of metronidazole (CHEBI:6909) |
| Incoming Relation(s) |
| metronidazole hydrochloride (CHEBI:50687) has part metronidazole(1+) (CHEBI:64682) |
| metronidazole (CHEBI:6909) is conjugate base of metronidazole(1+) (CHEBI:64682) |