EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9N3O3.HCl |
| Net Charge | 0 |
| Average Mass | 207.617 |
| Monoisotopic Mass | 207.04107 |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCO.Cl |
| InChI | InChI=1S/C6H9N3O3.ClH/c1-5-7-4-6(9(11)12)8(5)2-3-10;/h4,10H,2-3H2,1H3;1H |
| InChIKey | FPTPAIQTXYFGJC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antitrichomonal drug A drug used to treat trichomonas infections. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antitrichomonal drug A drug used to treat trichomonas infections. antibacterial drug A drug used to treat or prevent bacterial infections. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metronidazole hydrochloride (CHEBI:50687) has part metronidazole(1+) (CHEBI:64682) |
| metronidazole hydrochloride (CHEBI:50687) has role antiamoebic agent (CHEBI:171664) |
| metronidazole hydrochloride (CHEBI:50687) has role antibacterial drug (CHEBI:36047) |
| metronidazole hydrochloride (CHEBI:50687) has role antimicrobial agent (CHEBI:33281) |
| metronidazole hydrochloride (CHEBI:50687) has role antiparasitic agent (CHEBI:35442) |
| metronidazole hydrochloride (CHEBI:50687) has role antitrichomonal drug (CHEBI:50685) |
| metronidazole hydrochloride (CHEBI:50687) has role prodrug (CHEBI:50266) |
| metronidazole hydrochloride (CHEBI:50687) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethanol hydrochloride |
| Synonyms | Source |
|---|---|
| Metronidazole HCl | ChemIDplus |
| 2-Methyl-5-nitroimidazole-1-ethanol hydrochloride | ChemIDplus |
| 2-Methyl-5-nitroimidazole-1-ethanol monohydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Flagyl | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11001903 | Reaxys |
| CAS:69198-10-3 | ChemIDplus |
| Citations |
|---|