EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6909 - metronidazole
| Formula | C6H9N3O3 |
| Net Charge | 0 |
| Average Mass | 171.156 |
| Monoisotopic Mass | 171.06439 |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCO |
| InChI | InChI=1S/C6H9N3O3/c1-5-7-4-6(9(11)12)8(5)2-3-10/h4,10H,2-3H2,1H3 |
| InChIKey | VAOCPAMSLUNLGC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | antitrichomonal drug A drug used to treat trichomonas infections. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | antitrichomonal drug A drug used to treat trichomonas infections. antibacterial drug A drug used to treat or prevent bacterial infections. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metronidazole (CHEBI:6909) has role antiamoebic agent (CHEBI:171664) |
| metronidazole (CHEBI:6909) has role antibacterial drug (CHEBI:36047) |
| metronidazole (CHEBI:6909) has role antimicrobial agent (CHEBI:33281) |
| metronidazole (CHEBI:6909) has role antiparasitic agent (CHEBI:35442) |
| metronidazole (CHEBI:6909) has role antitrichomonal drug (CHEBI:50685) |
| metronidazole (CHEBI:6909) has role environmental contaminant (CHEBI:78298) |
| metronidazole (CHEBI:6909) has role prodrug (CHEBI:50266) |
| metronidazole (CHEBI:6909) has role radiosensitizing agent (CHEBI:132992) |
| metronidazole (CHEBI:6909) has role xenobiotic (CHEBI:35703) |
| metronidazole (CHEBI:6909) is a C-nitro compound (CHEBI:35716) |
| metronidazole (CHEBI:6909) is a imidazoles (CHEBI:24780) |
| metronidazole (CHEBI:6909) is a primary alcohol (CHEBI:15734) |
| metronidazole (CHEBI:6909) is conjugate base of metronidazole(1+) (CHEBI:64682) |
| Incoming Relation(s) |
| metronidazole benzoate (CHEBI:50688) has functional parent metronidazole (CHEBI:6909) |
| metronidazole(1+) (CHEBI:64682) is conjugate acid of metronidazole (CHEBI:6909) |
| IUPAC Name |
|---|
| 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethanol |
| INNs | Source |
|---|---|
| metronidazole | KEGG DRUG |
| métronidazole | WHO MedNet |
| metronidazol | WHO MedNet |
| metronidazolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(β-ethylol)-2-methyl-5-nitro-3-azapyrrole | NIST Chemistry WebBook |
| 1-(β-oxyethyl)-2-methyl-5-nitroimidazole | ChemIDplus |
| 2-methyl-1-(2-hydroxyethyl)-5-nitroimidazole | ChemIDplus |
| 1-(β-hydroxyethyl)-2-methyl-5-nitroimidazole | ChemIDplus |
| 1-(2-hydroxy-1-ethyl)-2-methyl-5-nitroimidazole | ChemIDplus |
| 1-(2-hydroxyethyl)-2-methyl-5-nitroimidazole | ChemIDplus |
| Citations |
|---|