EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15Cl2O4 |
| Net Charge | -1 |
| Average Mass | 306.165 |
| Monoisotopic Mass | 305.03529 |
| SMILES | CCCCCC(=O)c1c([O-])c(Cl)c(OC)c(Cl)c1O |
| InChI | InChI=1S/C13H16Cl2O4/c1-3-4-5-6-7(16)8-11(17)9(14)13(19-2)10(15)12(8)18/h17-18H,3-6H2,1-2H3/p-1 |
| InChIKey | VUDQSRFCCHQIIU-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one(1−) (CHEBI:90397) is a phenolate anion (CHEBI:50525) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one(1−) (CHEBI:90397) is conjugate base of 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) |
| Incoming Relation(s) |
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CHEBI:64598) is conjugate acid of 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one(1−) (CHEBI:90397) |
| IUPAC Name |
|---|
| 2,4-dichloro-6-hexanoyl-5-hydroxy-3-methoxyphenolate |
| Synonyms | Source |
|---|---|
| DIF 1(1−) | ChEBI |
| DIF-1(1−) | ChEBI |
| differentiation-inducing factor 1(1−) | ChEBI |
| differentiation-inducing factor-1(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-(3,5-dichloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one | UniProt |
| Citations |
|---|