EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:64557 - trans-sinapyl alcohol
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | COc1cc(/C=C/CO)cc(OC)c1O |
| InChI | InChI=1S/C11H14O4/c1-14-9-6-8(4-3-5-12)7-10(15-2)11(9)13/h3-4,6-7,12-13H,5H2,1-2H3/b4-3+ |
| InChIKey | LZFOPEXOUVTGJS-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Biological Roles: | monolignol A metabolite of plant origin (phytochemical) which acts as a source material for biosynthesis of both lignans and lignin. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-sinapyl alcohol (CHEBI:64557) has role monolignol (CHEBI:64477) |
| trans-sinapyl alcohol (CHEBI:64557) is a sinapyl alcohol (CHEBI:28813) |
| Incoming Relation(s) |
| syringal lignin (CHEBI:64476) has functional parent trans-sinapyl alcohol (CHEBI:64557) |
| syringin (CHEBI:9380) has functional parent trans-sinapyl alcohol (CHEBI:64557) |
| IUPAC Name |
|---|
| 4-[(1E)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenol |
| Synonym | Source |
|---|---|
| Sinapoyl alcohol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (E)-sinapyl alcohol | UniProt |
| Citations |
|---|