EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O9 |
| Net Charge | 0 |
| Average Mass | 372.370 |
| Monoisotopic Mass | 372.14203 |
| SMILES | COc1cc(/C=C/CO)cc(OC)c1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24O9/c1-23-10-6-9(4-3-5-18)7-11(24-2)16(10)26-17-15(22)14(21)13(20)12(8-19)25-17/h3-4,6-7,12-15,17-22H,5,8H2,1-2H3/b4-3+/t12-,13-,14+,15-,17+/m1/s1 |
| InChIKey | QJVXKWHHAMZTBY-GCPOEHJPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. hepatoprotective agent Any compound that is able to prevent damage to the liver. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| syringin (CHEBI:9380) has functional parent trans-sinapyl alcohol (CHEBI:64557) |
| syringin (CHEBI:9380) has role anti-inflammatory agent (CHEBI:67079) |
| syringin (CHEBI:9380) has role antidepressant (CHEBI:35469) |
| syringin (CHEBI:9380) has role apoptosis inducer (CHEBI:68495) |
| syringin (CHEBI:9380) has role autophagy inducer (CHEBI:138880) |
| syringin (CHEBI:9380) has role hepatoprotective agent (CHEBI:62868) |
| syringin (CHEBI:9380) has role neuroprotective agent (CHEBI:63726) |
| syringin (CHEBI:9380) has role plant metabolite (CHEBI:76924) |
| syringin (CHEBI:9380) is a dimethoxybenzene (CHEBI:51681) |
| syringin (CHEBI:9380) is a monosaccharide derivative (CHEBI:63367) |
| syringin (CHEBI:9380) is a primary alcohol (CHEBI:15734) |
| syringin (CHEBI:9380) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-[(1E)-3-hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 4-[(1E)-3-hydroxy-1-propen-1-yl]-2,6-dimethoxyphenyl β-D-glucopyranoside | ChEBI |
| beta-Terpineol | ChemIDplus |
| eleutheroside B | KEGG COMPOUND |
| eleutheroside B | ChemIDplus |
| (E)-sinapyl alcohol 4-glucoside | ChEBI |
| ligustrin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4-O-(β-D-glucosyl)-trans-4-sinapoyl alcohol | UniProt |
| Citations |
|---|