EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | COc1cc(C=CCO)cc(OC)c1O |
| InChI | InChI=1S/C11H14O4/c1-14-9-6-8(4-3-5-12)7-10(15-2)11(9)13/h3-4,6-7,12-13H,5H2,1-2H3 |
| InChIKey | LZFOPEXOUVTGJS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sinapyl alcohol (CHEBI:28813) has functional parent cinnamyl alcohol (CHEBI:17177) |
| sinapyl alcohol (CHEBI:28813) has role plant metabolite (CHEBI:76924) |
| sinapyl alcohol (CHEBI:28813) is a dimethoxybenzene (CHEBI:51681) |
| sinapyl alcohol (CHEBI:28813) is a phenols (CHEBI:33853) |
| sinapyl alcohol (CHEBI:28813) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| simulanol (CHEBI:86940) has functional parent sinapyl alcohol (CHEBI:28813) |
| trans-sinapyl alcohol (CHEBI:64557) is a sinapyl alcohol (CHEBI:28813) |
| IUPAC Name |
|---|
| 4-(3-hydroxyprop-1-en-1-yl)-2,6-dimethoxyphenol |
| Synonyms | Source |
|---|---|
| Sinapic alcohol | ChemIDplus |
| Sinapoyl alcohol | KEGG COMPOUND |
| Sinapyl alcohol | KEGG COMPOUND |
| Citations |
|---|