EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O8 |
| Net Charge | 0 |
| Average Mass | 410.378 |
| Monoisotopic Mass | 410.10017 |
| SMILES | COc1cc(=O)oc2c(-c3c(O)cc(C)c4c(OC)cc(=O)oc34)c(O)cc(C)c12 |
| InChI | InChI=1S/C22H18O8/c1-9-5-11(23)19(21-17(9)13(27-3)7-15(25)29-21)20-12(24)6-10(2)18-14(28-4)8-16(26)30-22(18)20/h5-8,23-24H,1-4H3 |
| InChIKey | SSGXAFNGBRRLQM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orlandin (CHEBI:64473) has role Aspergillus metabolite (CHEBI:76956) |
| orlandin (CHEBI:64473) is a 8,8'-bicoumarins (CHEBI:64462) |
| orlandin (CHEBI:64473) is conjugate acid of orlandin(1−) (CHEBI:145992) |
| Incoming Relation(s) |
| (+)-kotanin (CHEBI:64454) has functional parent orlandin (CHEBI:64473) |
| demethylkotanin (CHEBI:64465) has functional parent orlandin (CHEBI:64473) |
| orlandin(1−) (CHEBI:145992) is conjugate base of orlandin (CHEBI:64473) |
| IUPAC Name |
|---|
| 7,7'-dihydroxy-4,4'-dimethoxy-5,5'-dimethyl-2H,2'H-8,8'-bichromene-2,2'-dione |
| Synonym | Source |
|---|---|
| 7-hydroxy-8-(7-hydroxy-4-methoxy-5-methyl-2-oxochromen-8-yl)-4-methoxy-5-methylchromen-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7781683 | Reaxys |
| Citations |
|---|