EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22O8 |
| Net Charge | 0 |
| Average Mass | 438.432 |
| Monoisotopic Mass | 438.13147 |
| SMILES | COc1cc(C)c2c(OC)cc(=O)oc2c1-c1c(OC)cc(C)c2c(OC)cc(=O)oc12 |
| InChI | InChI=1S/C24H22O8/c1-11-7-13(27-3)21(23-19(11)15(29-5)9-17(25)31-23)22-14(28-4)8-12(2)20-16(30-6)10-18(26)32-24(20)22/h7-10H,1-6H3 |
| InChIKey | CSJOUDOXDHMIAH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-kotanin (CHEBI:64454) has functional parent orlandin (CHEBI:64473) |
| (+)-kotanin (CHEBI:64454) has role metabolite (CHEBI:25212) |
| (+)-kotanin (CHEBI:64454) is a 8,8'-bicoumarins (CHEBI:64462) |
| IUPAC Name |
|---|
| (P)-(+)-4,4',7,7'-tetramethoxy-5,5'-dimethyl-2H,2'H-8,8'-bichromene-2,2'-dione |
| Synonyms | Source |
|---|---|
| kotanin | ChemIDplus |
| (S)-4,4',7,7'-tetramethoxy-5,5'-dimethyl-2H,2'H-8,8'-bichromene-2,2'-dione | ChEBI |
| (aS)-(+)-4,4',7,7'-tetramethoxy-5,5'-dimethyl-2H,2'H-8,8'-bichromene-2,2'-dione | ChEBI |
| (P)-4,4',7,7'-tetramethoxy-5,5'-dimethyl-2H,2'H-8,8'-bichromene-2,2'-dione | ChEBI |
| (S)-(+)-4,4',7,7'-tetramethoxy-5,5'-dimethyl-2H,2'H-8,8'-bichromene-2,2'-dione | ChEBI |
| (+)-4,4',7,7'-tetramethoxy-5,5'-dimethyl-2H,2'H-8,8'-bichromene-2,2'-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9527113 | Reaxys |
| CAS:27909-08-6 | ChemIDplus |
| Citations |
|---|