EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20O8 |
| Net Charge | 0 |
| Average Mass | 424.405 |
| Monoisotopic Mass | 424.11582 |
| SMILES | COc1cc(C)c2c(OC)cc(=O)oc2c1-c1c(O)cc(C)c2c(OC)cc(=O)oc12 |
| InChI | InChI=1S/C23H20O8/c1-10-6-12(24)20(22-18(10)14(28-4)8-16(25)30-22)21-13(27-3)7-11(2)19-15(29-5)9-17(26)31-23(19)21/h6-9,24H,1-5H3 |
| InChIKey | WNAATGJTLYDMRY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| demethylkotanin (CHEBI:64465) has functional parent orlandin (CHEBI:64473) |
| demethylkotanin (CHEBI:64465) has role metabolite (CHEBI:25212) |
| demethylkotanin (CHEBI:64465) is a 8,8'-bicoumarins (CHEBI:64462) |
| IUPAC Name |
|---|
| 7-hydroxy-4,4',7'-trimethoxy-5,5'-dimethyl-2H,2'H-8,8'-bichromene-2,2'-dione |
| Synonym | Source |
|---|---|
| desmethylkotanin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1411948 | Reaxys |
| Citations |
|---|