EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12NO6S4 |
| Net Charge | -1 |
| Average Mass | 310.420 |
| Monoisotopic Mass | 309.95529 |
| SMILES | CN(C)C(CSS(=O)(=O)[O-])CSS(=O)(=O)O |
| InChI | InChI=1S/C5H13NO6S4/c1-6(2)5(3-13-15(7,8)9)4-14-16(10,11)12/h5H,3-4H2,1-2H3,(H,7,8,9)(H,10,11,12)/p-1 |
| InChIKey | PYNKFIVDSJSNGL-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiosultap(1−) (CHEBI:64387) is a S-alkyl thiosulfate anion (CHEBI:58619) |
| thiosultap(1−) (CHEBI:64387) is conjugate acid of thiosultap(2−) (CHEBI:64385) |
| thiosultap(1−) (CHEBI:64387) is conjugate base of thiosultap (CHEBI:39199) |
| Incoming Relation(s) |
| thiosultap monosodium (CHEBI:64386) has part thiosultap(1−) (CHEBI:64387) |
| thiosultap (CHEBI:39199) is conjugate acid of thiosultap(1−) (CHEBI:64387) |
| thiosultap(2−) (CHEBI:64385) is conjugate base of thiosultap(1−) (CHEBI:64387) |
| IUPAC Name |
|---|
| S-[2-(dimethylamino)-3-(sulfosulfanyl)propyl] sulfurothioate |
| Synonym | Source |
|---|---|
| thiosultap monoanion | ChEBI |