EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13NO6S4 |
| Net Charge | 0 |
| Average Mass | 311.428 |
| Monoisotopic Mass | 310.96257 |
| SMILES | CN(C)C(CSS(=O)(=O)O)CSS(=O)(=O)O |
| InChI | InChI=1S/C5H13NO6S4/c1-6(2)5(3-13-15(7,8)9)4-14-16(10,11)12/h5H,3-4H2,1-2H3,(H,7,8,9)(H,10,11,12) |
| InChIKey | PYNKFIVDSJSNGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiosultap (CHEBI:39199) is a nereistoxin analogue insecticide (CHEBI:39191) |
| thiosultap (CHEBI:39199) is conjugate acid of thiosultap(1−) (CHEBI:64387) |
| Incoming Relation(s) |
| thiosultap(1−) (CHEBI:64387) is conjugate base of thiosultap (CHEBI:39199) |
| IUPAC Name |
|---|
| S,S'-[2-(dimethylamino)propane-1,3-diyl] bis[hydrogen(thiosulfate)] |
| Synonyms | Source |
|---|---|
| S,S'-(2-(dimethylamino)-1,3-propanediyl)thiosulfuric acid ester | ChemIDplus |
| thiosulfuric acid (H2S2O3), S,S'-(2-(dimethylamino)-1,3-propanediyl) ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1485 | PPDB |
| WO2011102354 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1986805 | Reaxys |
| CAS:98968-92-4 | ChemIDplus |