EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12NO6S4.Na |
| Net Charge | 0 |
| Average Mass | 333.410 |
| Monoisotopic Mass | 332.94452 |
| SMILES | CN(C)C(CSS(=O)(=O)[O-])CSS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C5H13NO6S4.Na/c1-6(2)5(3-13-15(7,8)9)4-14-16(10,11)12;/h5H,3-4H2,1-2H3,(H,7,8,9)(H,10,11,12);/q;+1/p-1 |
| InChIKey | MBNMHBAJUNHZRE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiosultap monosodium (CHEBI:64386) has part thiosultap(1−) (CHEBI:64387) |
| thiosultap monosodium (CHEBI:64386) has role insecticide (CHEBI:24852) |
| thiosultap monosodium (CHEBI:64386) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium S-[2-(dimethylamino)-3-(sulfosulfanyl)propyl] sulfurothioate |
| Synonyms | Source |
|---|---|
| monosultap | ChEBI |
| S,S'-(2-(Dimethylamino)trimethylene)thiosulfate sodium salt | ChemIDplus |
| Thiosultap-monosodium | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1486 | PPDB |
| CN101204155 | Patent |
| CN101268779 | Patent |
| CN101293862 | Patent |
| CN101648898 | Patent |
| CN101669470 | Patent |
| WO2011066770 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18567209 | Reaxys |
| CAS:29547-00-0 | ChemIDplus |
| Citations |
|---|