EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N3O2S |
| Net Charge | +1 |
| Average Mass | 296.416 |
| Monoisotopic Mass | 296.14272 |
| SMILES | CNS(=O)(=O)Cc1ccc2ncc(CC[NH+](C)C)c2c1 |
| InChI | InChI=1S/C14H21N3O2S/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3/h4-5,8-9,15-16H,6-7,10H2,1-3H3/p+1 |
| InChIKey | KQKPFRSPSRPDEB-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sumatriptan(1+) (CHEBI:64364) is a ammonium ion derivative (CHEBI:35274) |
| sumatriptan(1+) (CHEBI:64364) is a organic cation (CHEBI:25697) |
| sumatriptan(1+) (CHEBI:64364) is conjugate acid of sumatriptan (CHEBI:10650) |
| Incoming Relation(s) |
| sumatriptan succinate (CHEBI:64359) has part sumatriptan(1+) (CHEBI:64364) |
| sumatriptan (CHEBI:10650) is conjugate base of sumatriptan(1+) (CHEBI:64364) |
| IUPAC Name |
|---|
| N,N-dimethyl-2-{5-[(methylsulfamoyl)methyl]-1H-indol-3-yl}ethanaminium |
| Synonym | Source |
|---|---|
| sumatriptan cation | ChEBI |