EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N3O2S.C4H6O4 |
| Net Charge | 0 |
| Average Mass | 413.496 |
| Monoisotopic Mass | 413.16206 |
| SMILES | CNS(=O)(=O)Cc1ccc2ncc(CCN(C)C)c2c1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C14H21N3O2S.C4H6O4/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3;5-3(6)1-2-4(7)8/h4-5,8-9,15-16H,6-7,10H2,1-3H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | PORMUFZNYQJOEI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sumatriptan succinate (CHEBI:64359) has part sumatriptan(1+) (CHEBI:64364) |
| sumatriptan succinate (CHEBI:64359) has role serotonergic agonist (CHEBI:35941) |
| sumatriptan succinate (CHEBI:64359) has role vasoconstrictor agent (CHEBI:50514) |
| sumatriptan succinate (CHEBI:64359) is a succinate salt (CHEBI:51381) |
| IUPAC Name |
|---|
| 1-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-N-methylmethanesulfonamide butanedioate |
| Synonyms | Source |
|---|---|
| 1-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-N-methylmethanesulfonamide succinate | ChEBI |
| 3-(2-(Dimethylamino)ethyl)-N-methylindole-5-methanesulfonamide succinate | ChemIDplus |
| N,N-dimethyl-2-{5-[(methylsulfamoyl)methyl]-1H-indol-3-yl}ethanaminium 3-carboxypropanoate | IUPAC |
| sumatriptan hydrogen succinate | ChEBI |
| Brand Names | Source |
|---|---|
| Imitrex | DrugBank |
| ONZETRA Xsail | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D00676 | KEGG DRUG |
| DB00669 | DrugBank |
| US2010008986 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5371868 | Reaxys |
| CAS:103628-48-4 | ChemIDplus |
| CAS:103628-48-4 | KEGG DRUG |
| Citations |
|---|