EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N2O2 |
| Net Charge | +1 |
| Average Mass | 251.350 |
| Monoisotopic Mass | 251.17540 |
| SMILES | CCN(C)C(=O)Oc1cccc([C@H](C)[NH+](C)C)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4/h7-11H,6H2,1-5H3/p+1/t11-/m0/s1 |
| InChIKey | XSVMFMHYUFZWBK-NSHDSACASA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rivastigmine(1+) (CHEBI:64363) is a ammonium ion derivative (CHEBI:35274) |
| rivastigmine(1+) (CHEBI:64363) is a organic cation (CHEBI:25697) |
| rivastigmine(1+) (CHEBI:64363) is conjugate acid of rivastigmine (CHEBI:8874) |
| Incoming Relation(s) |
| rivastigmine tartrate (CHEBI:64358) has part rivastigmine(1+) (CHEBI:64363) |
| rivastigmine (CHEBI:8874) is conjugate base of rivastigmine(1+) (CHEBI:64363) |
| IUPAC Name |
|---|
| (1S)-1-(3-{[ethyl(methyl)carbamoyl]oxy}phenyl)-N,N-dimethylethanaminium |
| Synonyms | Source |
|---|---|
| rivastigmine cation | ChEBI |
| rivastigminium(1+) | ChEBI |
| rivastigminium cation | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25271873 | Reaxys |