EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O2 |
| Net Charge | 0 |
| Average Mass | 250.342 |
| Monoisotopic Mass | 250.16813 |
| SMILES | CCN(C)C(=O)Oc1cccc([C@H](C)N(C)C)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4/h7-11H,6H2,1-5H3/t11-/m0/s1 |
| InChIKey | XSVMFMHYUFZWBK-NSHDSACASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rivastigmine (CHEBI:8874) has role cholinergic drug (CHEBI:38323) |
| rivastigmine (CHEBI:8874) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| rivastigmine (CHEBI:8874) has role neuroprotective agent (CHEBI:63726) |
| rivastigmine (CHEBI:8874) is a carbamate ester (CHEBI:23003) |
| rivastigmine (CHEBI:8874) is a tertiary amino compound (CHEBI:50996) |
| rivastigmine (CHEBI:8874) is conjugate base of rivastigmine(1+) (CHEBI:64363) |
| Incoming Relation(s) |
| rivastigmine(1+) (CHEBI:64363) is conjugate acid of rivastigmine (CHEBI:8874) |
| IUPAC Name |
|---|
| 3-[(1S)-1-(dimethylamino)ethyl]phenyl ethyl(methyl)carbamate |
| INN | Source |
|---|---|
| rivastigmine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| m-((S)-1-(Dimethylamino)ethyl)phenyl ethylmethylcarbamate | ChemIDplus |
| (S)-3-(1-(Dimethylamino)ethyl)phenyl ethylmethylcarbamate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2392 | DrugCentral |
| C11766 | KEGG COMPOUND |
| D03822 | KEGG DRUG |
| DB00989 | DrugBank |
| DE3805744 | Patent |
| EP1980552 | Patent |
| EP2233465 | Patent |
| LSM-5280 | LINCS |
| Rivastigmine | Wikipedia |
| US2008255383 | Patent |
| US2009298817 | Patent |
| US5602176 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7875788 | Reaxys |
| CAS:123441-03-2 | ChemIDplus |
| CAS:123441-03-2 | KEGG COMPOUND |
| Citations |
|---|