EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O2 |
| Net Charge | 0 |
| Average Mass | 250.342 |
| Monoisotopic Mass | 250.16813 |
| SMILES | CCN(C)C(=O)Oc1cccc([C@H](C)N(C)C)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4/h7-11H,6H2,1-5H3/t11-/m0/s1 |
| InChIKey | XSVMFMHYUFZWBK-NSHDSACASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. antiparkinson drug A drug used in the treatment of Parkinson's disease. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rivastigmine (CHEBI:8874) has role antidepressant (CHEBI:35469) |
| rivastigmine (CHEBI:8874) has role antiparkinson drug (CHEBI:48407) |
| rivastigmine (CHEBI:8874) has role antipsychotic agent (CHEBI:35476) |
| rivastigmine (CHEBI:8874) has role anxiolytic drug (CHEBI:35474) |
| rivastigmine (CHEBI:8874) has role cholinergic drug (CHEBI:38323) |
| rivastigmine (CHEBI:8874) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| rivastigmine (CHEBI:8874) has role neuroprotective agent (CHEBI:63726) |
| rivastigmine (CHEBI:8874) is a carbamate ester (CHEBI:23003) |
| rivastigmine (CHEBI:8874) is a tertiary amino compound (CHEBI:50996) |
| rivastigmine (CHEBI:8874) is conjugate base of rivastigmine(1+) (CHEBI:64363) |
| Incoming Relation(s) |
| rivastigmine(1+) (CHEBI:64363) is conjugate acid of rivastigmine (CHEBI:8874) |
| IUPAC Name |
|---|
| 3-[(1S)-1-(dimethylamino)ethyl]phenyl ethyl(methyl)carbamate |
| INNs | Source |
|---|---|
| rivastigmina | WHO MedNet |
| rivastigmine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| ENA-713 | ChEMBL |
| ENA-713D | ChEMBL |
| m-((S)-1-(Dimethylamino)ethyl)phenyl ethylmethylcarbamate | ChemIDplus |
| ONO-2540 | ChEMBL |
| (S)-3-(1-(Dimethylamino)ethyl)phenyl ethylmethylcarbamate | ChemIDplus |
| SDZ-212-713 | ChEMBL |
| Brand Name | Source |
|---|---|
| Rivastigmine 3m health care ltd | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2392 | DrugCentral |
| C11766 | KEGG COMPOUND |
| D03822 | KEGG DRUG |
| DB00989 | DrugBank |
| DE3805744 | Patent |
| EP1980552 | Patent |
| EP2233465 | Patent |
| LSM-5280 | LINCS |
| Rivastigmine | Wikipedia |
| US2008255383 | Patent |
| US2009298817 | Patent |
| US5602176 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7875788 | Reaxys |
| CAS:123441-03-2 | ChemIDplus |
| CAS:123441-03-2 | KEGG COMPOUND |
| Citations |
|---|