EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O2.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 400.428 |
| Monoisotopic Mass | 400.18457 |
| SMILES | CCN(C)C(=O)Oc1cccc([C@H](C)N(C)C)c1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C14H22N2O2.C4H6O6/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4;5-1(3(7)8)2(6)4(9)10/h7-11H,6H2,1-5H3;1-2,5-6H,(H,7,8)(H,9,10)/t11-;1-,2-/m01/s1 |
| InChIKey | GWHQHAUAXRMMOT-MBANBULQSA-N |
| Roles Classification |
|---|
| Biological Roles: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. vasoconstrictor agent Drug used to cause constriction of the blood vessels. antiparkinson drug A drug used in the treatment of Parkinson's disease. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rivastigmine tartrate (CHEBI:64358) has part rivastigmine(1+) (CHEBI:64363) |
| rivastigmine tartrate (CHEBI:64358) has role antiparkinson drug (CHEBI:48407) |
| rivastigmine tartrate (CHEBI:64358) has role cholinergic drug (CHEBI:38323) |
| rivastigmine tartrate (CHEBI:64358) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| rivastigmine tartrate (CHEBI:64358) has role neuroprotective agent (CHEBI:63726) |
| rivastigmine tartrate (CHEBI:64358) has role vasoconstrictor agent (CHEBI:50514) |
| rivastigmine tartrate (CHEBI:64358) is a tartrate salt (CHEBI:50562) |
| IUPAC Name |
|---|
| 3-[(1S)-1-(dimethylamino)ethyl]phenyl ethyl(methyl)carbamate (2R,3R)-2,3-dihydroxybutanedioate |
| Synonyms | Source |
|---|---|
| (1S)-1-(3-{[ethyl(methyl)carbamoyl]oxy}phenyl)-N,N-dimethylethanaminium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate | IUPAC |
| ENA 713 | ChEMBL |
| Rivastigmine actavis | ChEMBL |
| Rivastigmine bitartrate | ChEMBL |
| rivastigmine hydrogen tartrate | DrugBank |
| Rivastigmine hydrogentartrate | ChEMBL |
| Brand Names | Source |
|---|---|
| Exelon | KEGG DRUG |
| Exelon tartrate | ChEMBL |
| Nimvastid | ChEMBL |
| Rivastigmine 1 a pharma | ChEMBL |
| Rivastigmine sandoz | ChEMBL |
| Rivastigmine teva | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D02558 | KEGG DRUG |
| DB00989 | DrugBank |
| EP1980552 | Patent |
| EP2233465 | Patent |
| US2008255383 | Patent |
| US2008306280 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9305032 | Reaxys |
| CAS:129101-54-8 | ChemIDplus |
| CAS:129101-54-8 | KEGG DRUG |
| Citations |
|---|