EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N2O2.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 400.428 |
| Monoisotopic Mass | 400.18457 |
| SMILES | CCN(C)C(=O)Oc1cccc([C@H](C)N(C)C)c1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C14H22N2O2.C4H6O6/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4;5-1(3(7)8)2(6)4(9)10/h7-11H,6H2,1-5H3;1-2,5-6H,(H,7,8)(H,9,10)/t11-;1-,2-/m01/s1 |
| InChIKey | GWHQHAUAXRMMOT-MBANBULQSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rivastigmine tartrate (CHEBI:64358) has part rivastigmine(1+) (CHEBI:64363) |
| rivastigmine tartrate (CHEBI:64358) has role cholinergic drug (CHEBI:38323) |
| rivastigmine tartrate (CHEBI:64358) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| rivastigmine tartrate (CHEBI:64358) has role neuroprotective agent (CHEBI:63726) |
| rivastigmine tartrate (CHEBI:64358) is a tartrate salt (CHEBI:50562) |
| IUPAC Name |
|---|
| 3-[(1S)-1-(dimethylamino)ethyl]phenyl ethyl(methyl)carbamate (2R,3R)-2,3-dihydroxybutanedioate |
| Synonyms | Source |
|---|---|
| (1S)-1-(3-{[ethyl(methyl)carbamoyl]oxy}phenyl)-N,N-dimethylethanaminium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate | IUPAC |
| rivastigmine hydrogen tartrate | DrugBank |
| SDZ-ENA 713 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Exelon | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02558 | KEGG DRUG |
| DB00989 | DrugBank |
| EP1980552 | Patent |
| EP2233465 | Patent |
| US2008255383 | Patent |
| US2008306280 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9305032 | Reaxys |
| CAS:129101-54-8 | KEGG DRUG |
| CAS:129101-54-8 | ChemIDplus |
| Citations |
|---|