EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O3 |
| Net Charge | 0 |
| Average Mass | 184.235 |
| Monoisotopic Mass | 184.10994 |
| SMILES | C=C(C)C(CCC(C)=O)CC(=O)O |
| InChI | InChI=1S/C10H16O3/c1-7(2)9(6-10(12)13)5-4-8(3)11/h9H,1,4-6H2,2-3H3,(H,12,13) |
| InChIKey | NJOIWWRMLFSDTM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-isopropenyl-6-oxoheptanoic acid (CHEBI:64264) has functional parent heptanoic acid (CHEBI:45571) |
| 3-isopropenyl-6-oxoheptanoic acid (CHEBI:64264) is a 6-oxo monocarboxylic acid (CHEBI:35960) |
| 3-isopropenyl-6-oxoheptanoic acid (CHEBI:64264) is conjugate acid of 3-isopropenyl-6-oxoheptanoate (CHEBI:64234) |
| Incoming Relation(s) |
| (3R)-3-isopropenyl-6-oxoheptanoic acid (CHEBI:37287) is a 3-isopropenyl-6-oxoheptanoic acid (CHEBI:64264) |
| (3S)-3-isopropenyl-6-oxoheptanoic acid (CHEBI:37291) is a 3-isopropenyl-6-oxoheptanoic acid (CHEBI:64264) |
| 3-isopropenyl-6-oxoheptanoate (CHEBI:64234) is conjugate base of 3-isopropenyl-6-oxoheptanoic acid (CHEBI:64264) |
| IUPAC Name |
|---|
| 6-oxo-3-(prop-1-en-2-yl)heptanoic acid |
| Synonym | Source |
|---|---|
| limononic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3-Isopropenyl-6-oxoheptanoates | MetaCyc |
| Citations |
|---|