EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15O3 |
| Net Charge | -1 |
| Average Mass | 183.227 |
| Monoisotopic Mass | 183.10267 |
| SMILES | C=C(C)C(CCC(C)=O)CC(=O)[O-] |
| InChI | InChI=1S/C10H16O3/c1-7(2)9(6-10(12)13)5-4-8(3)11/h9H,1,4-6H2,2-3H3,(H,12,13)/p-1 |
| InChIKey | NJOIWWRMLFSDTM-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-isopropenyl-6-oxoheptanoate (CHEBI:64234) has functional parent heptanoate (CHEBI:32362) |
| 3-isopropenyl-6-oxoheptanoate (CHEBI:64234) is a 6-oxo monocarboxylic acid anion (CHEBI:35976) |
| 3-isopropenyl-6-oxoheptanoate (CHEBI:64234) is conjugate base of 3-isopropenyl-6-oxoheptanoic acid (CHEBI:64264) |
| Incoming Relation(s) |
| (3R)-3-isopropenyl-6-oxoheptanoate (CHEBI:29001) is a 3-isopropenyl-6-oxoheptanoate (CHEBI:64234) |
| (3S)-3-isopropenyl-6-oxoheptanoate (CHEBI:211) is a 3-isopropenyl-6-oxoheptanoate (CHEBI:64234) |
| 3-isopropenyl-6-oxoheptanoic acid (CHEBI:64264) is conjugate acid of 3-isopropenyl-6-oxoheptanoate (CHEBI:64234) |
| IUPAC Name |
|---|
| 6-oxo-3-(prop-1-en-2-yl)heptanoate |
| UniProt Name | Source |
|---|---|
| 3-isopropenyl-6-oxoheptanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3-Isopropenyl-6-oxoheptanoates | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1779428 | Reaxys |
| Citations |
|---|