EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32362 - heptanoate
| Formula | C7H13O2 |
| Net Charge | -1 |
| Average Mass | 129.179 |
| Monoisotopic Mass | 129.09210 |
| SMILES | CCCCCCC(=O)[O-] |
| InChI | InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9)/p-1 |
| InChIKey | MNWFXJYAOYHMED-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptanoate (CHEBI:32362) has role plant metabolite (CHEBI:76924) |
| heptanoate (CHEBI:32362) is a medium-chain fatty acid anion (CHEBI:59558) |
| heptanoate (CHEBI:32362) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| heptanoate (CHEBI:32362) is conjugate base of heptanoic acid (CHEBI:45571) |
| Incoming Relation(s) |
| O-heptanoyl-L-serine residue (CHEBI:177290) has functional parent heptanoate (CHEBI:32362) |
| 1-heptanoyl-2-hexanoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:138217) has functional parent heptanoate (CHEBI:32362) |
| 2,4,6-trioxoheptanoate (CHEBI:19338) has functional parent heptanoate (CHEBI:32362) |
| 3-isopropenyl-6-oxoheptanoate (CHEBI:64234) has functional parent heptanoate (CHEBI:32362) |
| heptanoic acid (CHEBI:45571) is conjugate acid of heptanoate (CHEBI:32362) |
| IUPAC Name |
|---|
| heptanoate |
| Synonyms | Source |
|---|---|
| 1-hexanecarboxylate | ChEBI |
| (7:0) | ChEBI |
| CH3‒[CH2]5‒COO− | IUPAC |
| enanthate | ChEBI |
| enanthylate | ChEBI |
| heptanoic acid, ion(1−) | ChemIDplus |
| UniProt Name | Source |
|---|---|
| heptanoate | UniProt |
| Citations |
|---|