EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18Cl2N |
| Net Charge | +1 |
| Average Mass | 307.244 |
| Monoisotopic Mass | 306.08108 |
| SMILES | [H][C@@]1(c2ccc(Cl)c(Cl)c2)CC[C@H]([NH2+]C)c2ccccc21 |
| InChI | InChI=1S/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/p+1/t12-,17-/m0/s1 |
| InChIKey | VGKDLMBJGBXTGI-SJCJKPOMSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sertraline(1+) (CHEBI:64214) is a ammonium ion derivative (CHEBI:35274) |
| sertraline(1+) (CHEBI:64214) is a organic cation (CHEBI:25697) |
| sertraline(1+) (CHEBI:64214) is conjugate acid of sertraline (CHEBI:9123) |
| Incoming Relation(s) |
| sertraline hydrochloride (CHEBI:9124) has part sertraline(1+) (CHEBI:64214) |
| sertraline (CHEBI:9123) is conjugate base of sertraline(1+) (CHEBI:64214) |
| IUPAC Name |
|---|
| (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-aminium |