EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17Cl2N |
| Net Charge | 0 |
| Average Mass | 306.236 |
| Monoisotopic Mass | 305.07380 |
| SMILES | [H][C@@]1(c2ccc(Cl)c(Cl)c2)CC[C@H](NC)c2ccccc21 |
| InChI | InChI=1S/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/t12-,17-/m0/s1 |
| InChIKey | VGKDLMBJGBXTGI-SJCJKPOMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sertraline (CHEBI:9123) has parent hydride tetralin (CHEBI:35008) |
| sertraline (CHEBI:9123) has role antidepressant (CHEBI:35469) |
| sertraline (CHEBI:9123) has role serotonin uptake inhibitor (CHEBI:50949) |
| sertraline (CHEBI:9123) is a dichlorobenzene (CHEBI:23697) |
| sertraline (CHEBI:9123) is a secondary amino compound (CHEBI:50995) |
| sertraline (CHEBI:9123) is a tetralins (CHEBI:36786) |
| sertraline (CHEBI:9123) is conjugate base of sertraline(1+) (CHEBI:64214) |
| Incoming Relation(s) |
| sertraline(1+) (CHEBI:64214) is conjugate acid of sertraline (CHEBI:9123) |
| IUPAC Name |
|---|
| (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| INNs | Source |
|---|---|
| sertralina | ChemIDplus |
| sertraline | ChemIDplus |
| sertralinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (1S,4S)-sertraline | ChemIDplus |
| (1S-cis)-1,2,3,4-tetrahydro-4-(3,4-dichlorophenyl)-N-methyl-1-naphthalenamine | ChemIDplus |
| CP 51974 | NIST Chemistry WebBook |
| cis-(+)-sertraline | ChEBI |
| (+)-sertraline | ChEBI |
| Sertraline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2436 | DrugCentral |
| C07246 | KEGG COMPOUND |
| D02360 | KEGG DRUG |
| DB01104 | DrugBank |
| HMDB0005010 | HMDB |
| LSM-3843 | LINCS |
| Sertraline | Wikipedia |
| SRE | PDBeChem |
| US4536518 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5753709 | Reaxys |
| CAS:79617-96-2 | NIST Chemistry WebBook |
| CAS:79617-96-2 | ChemIDplus |
| CAS:79617-96-2 | KEGG COMPOUND |
| Citations |
|---|