EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17Cl2N.HCl |
| Net Charge | 0 |
| Average Mass | 342.697 |
| Monoisotopic Mass | 341.05048 |
| SMILES | Cl.[H][C@@]1(c2ccc(Cl)c(Cl)c2)CC[C@H](NC)c2ccccc21 |
| InChI | InChI=1S/C17H17Cl2N.ClH/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11;/h2-6,8,10,12,17,20H,7,9H2,1H3;1H/t12-,17-;/m0./s1 |
| InChIKey | BLFQGGGGFNSJKA-XHXSRVRCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. |
| Applications: | serotonin uptake inhibitor A compound that specifically inhibits the reuptake of serotonin in the brain. This increases the serotonin concentration in the synaptic cleft which then activates serotonin receptors to a greater extent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sertraline hydrochloride (CHEBI:9124) has part sertraline(1+) (CHEBI:64214) |
| sertraline hydrochloride (CHEBI:9124) has role antidepressant (CHEBI:35469) |
| sertraline hydrochloride (CHEBI:9124) has role serotonin uptake inhibitor (CHEBI:50949) |
| sertraline hydrochloride (CHEBI:9124) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride |
| Synonyms | Source |
|---|---|
| (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-aminium chloride | IUPAC |
| (1S-cis)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride | ChEBI |
| (+)-cis-(1S,4S)-1-methylamino-4-(3,4-dichlorophenyl)tetralin hydrochloride | ChEBI |
| sertraline HCl | ChemIDplus |
| (+)-sertraline hydrochloride | ChEBI |
| Brand Names | Source |
|---|---|
| Lustral | ChEBI |
| Zoloft | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00825 | KEGG DRUG |
| DB01104 | DrugBank |
| HMDB0005010 | HMDB |
| Sertraline | Wikipedia |
| US2008161412 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5783715 | Reaxys |
| CAS:79559-97-0 | KEGG DRUG |
| CAS:79559-97-0 | ChemIDplus |
| Citations |
|---|